ansoxetine

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 451564773

| IUPAC_name = 6-[3-(dimethylamino)-1-phenylpropoxy]-2-phenyl-4H-chromen-4-one

| image = Ansoxetine.png

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 79130-64-6

| ATC_prefix = None

| ATC_suffix =

| PubChem = 179333

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 156100

| ChEMBL = 2104191

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3LY71185IQ

| C=26 | H=25 | N=1 | O=3

| smiles = O=C\1c4c(O/C(=C/1)c2ccccc2)ccc(OC(c3ccccc3)CCN(C)C)c4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C26H25NO3/c1-27(2)16-15-24(19-9-5-3-6-10-19)29-21-13-14-25-22(17-21)23(28)18-26(30-25)20-11-7-4-8-12-20/h3-14,17-18,24H,15-16H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JDQWJVUVMKPZLU-UHFFFAOYSA-N

}}

Ansoxetine is the trade name of a type of antidepressant medication. It was never marketed.{{cite book | vauthors = Triggle DJ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 978-0-412-46630-4 }}