apoatropine

{{Chembox

| ImageFile = Apoatropine.svg

| ImageClass = skin-invert-image

| ImageSize = 200px

| IUPACName = (8-Methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylprop-2-enoate

| OtherNames = Apoatropine Hydrochloride, Atropamin Hydrochloride, Atropyltropeine Hydrochloride, Apoascyamine, and Atropane.

| Section1 = {{Chembox Identifiers

| CASNo = 500-55-0

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 58243

| EC_number = 207-906-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3B4C10J0BP

| PubChem = 64695

| SMILES = CN1C2CCC1CC(C2)OC(=O)C(=C)C3=CC=CC=C3

| InChI = InChI=1S/C17H21NO2/c1-12(13-6-4-3-5-7-13)17(19)20-16-10-14-8-9-15(11-16)18(14)2/h3-7,14-16H,1,8-11H2,2H3 {{cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/64695#section=Top|title=Apoatropine|author=Pubchem|work=nih.gov}}

| InChIKey = WPUIZWXOSDVQJU-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=17 | H=21 | N=1 | O=2

| Appearance = White or off whiteish and crystalline

| Density =

| MeltingPt = >236 °C

| MeltingPt_notes = (HCl salt, decomposes){{cite web | url = https://www.scbt.com/scbt/product/apoatropine-hydrochloride | title = Apoatropine Hydrochloride | publisher = Santa Cruz Biotechnology}}

| BoilingPt =

| Solubility = Soluble in water, alcohol, and ether

}}

| Section3 = {{Chembox Hazards

| MainHazards = Considered poisonous

| FlashPtC =

| AutoignitionPt =

}}

}}

Apoatropine (atropatropine) is a member of class of tropane alkaloids. Chemically, it is an ester formed from tropine and atropic acid. Apoatropine can be found in plants of family Solanaceae. It is a bitter crystalline alkaloid. Examples of related tropane alkaloids include atropine, hyoscyamine, and hyoscine. Though apoatropine is found in various plants, it can also be prepared by the dehydration of atropine using nitric acid . Apoatropine is used as a pigment.{{citation needed|date=November 2018}}