apocarotenal

{{chembox

| Watchedfields = changed

| verifiedrevid = 443396159

| ImageFile = Apocarotenal Structural Formula V1.svg

| ImageSize = 320px

| ImageAlt = Skeletal formula of apocarotenal

| ImageFile1 = Apocarotenal 3D spacefill.png

| ImageSize1 = 300

| ImageAlt1 = Space-filling model of the apocarotenal molecule

| IUPACName = 8′-Apo-β-caroten-8′-al

| SystematicName = (2E,4E,6E,8E,10E,12E,14E,16E)-2,6,11,15-Tetramethyl-17-(2,6,6-trimethylcyclohex-1-en-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaenal

| OtherNames={{Unbulleted list

| trans-beta-apo-8'-carotenal

| C.I. Food Orange 6

| E number 160E

}}

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4585625

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C30H40O/c1-24(13-8-9-14-25(2)16-11-18-27(4)23-31)15-10-17-26(3)20-21-29-28(5)19-12-22-30(29,6)7/h8-11,13-18,20-21,23H,12,19,22H2,1-7H3/b9-8+,15-10+,16-11+,21-20+,24-13+,25-14+,26-17+,27-18+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DFMMVLFMMAQXHZ-DOKBYWHISA-N

| SMILES1 = O=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C1=C(\CCCC1(C)C)C)C)C)C)C

| InChI = 1S/C30H40O/c1-24(13-8-9-14-25(2)16-11-18-27(4)23-31)15-10-17-26(3)20-21-29-28(5)19-12-22-30(29,6)7/h8-11,13-18,20-21,23H,12,19,22H2,1-7H3/b9-8+,15-10+,16-11+,21-20+,24-13+,25-14+,26-17+,27-18+

| InChIKey1 = DFMMVLFMMAQXHZ-DOKBYWHISA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=1107-26-2

| PubChem=5478003

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V22N3E2U32

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 53154

| SMILES=CC=1CCCC(C)(C)C=1/C=CC(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)C=O

}}

|Section2={{Chembox Properties

| C=30 | H=40 | O=1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Apocarotenal, or trans-β-apo-8'-carotenal, is a carotenoid found in spinach and citrus fruits. Like other carotenoids, apocarotenal plays a role as a precursor of vitamin A, even though it has 50% less pro-vitamin A activity than β-carotene. The empirical chemical formula for apocarotenal is C₃₀H₄₀O.

Apocarotenal has an orange to orange-red colour and is used in foods, pharmaceuticals and cosmetic products. Depending on the product forms, apocarotenal is used in fat based food (margarine, sauces, salad dressing), beverages, dairy products and sweets. Its E number is E160e and it is approved for usage as a food additive in the US,US FDA:{{cite web |url=https://www.fda.gov/ForIndustry/ColorAdditives/ColorAdditiveInventories/ucm106626.htm |title=Colour Additive Status List |website=Food and Drug Administration |accessdate=2011-10-27}} EUUK Food Standards Agency: {{cite web |url=http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist |title=Current EU approved additives and their E Numbers |accessdate=2011-10-27}} and Australia and New Zealand.Australia New Zealand Food Standards Code{{cite web |url=http://www.comlaw.gov.au/Details/F2011C00827 |title=Standard 1.2.4 - Labelling of ingredients |date=8 September 2011 |accessdate=2011-10-27}}