apterin
{{chembox
| verifiedrevid = 459709967
| ImageFile=Apterin.png
| ImageFile2=Apterin 3D sticks.png
| IUPACName=(8S,9R)-8-[2-(β-D-Glucopyranosyloxy)propan-2-yl]-9-hydroxy-8,9-dihydro-2H-furo[2,3-h][1]benzopyran-2-one
| SystematicName=(8S,9R)-9-Hydroxy-8-(2-
| OtherNames=
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=53947-89-0
| PubChem=15945058
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 26286869
| SMILES = CC(C)([C@@H]1[C@@H](c2c(ccc3c2oc(=O)cc3)O1)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O
| InChI = 1/C20H24O10/c1-20(2,30-19-16(26)15(25)13(23)10(7-21)28-19)18-14(24)12-9(27-18)5-3-8-4-6-11(22)29-17(8)12/h3-6,10,13-16,18-19,21,23-26H,7H2,1-2H3/t10-,13-,14-,15+,16-,18+,19+/m1/s1
| InChIKey = ALEQYOXVXJKFOM-KTZZUYPUBG
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H24O10/c1-20(2,30-19-16(26)15(25)13(23)10(7-21)28-19)18-14(24)12-9(27-18)5-3-8-4-6-11(22)29-17(8)12/h3-6,10,13-16,18-19,21,23-26H,7H2,1-2H3/t10-,13-,14-,15+,16-,18+,19+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ALEQYOXVXJKFOM-KTZZUYPUSA-N
}}
|Section2={{Chembox Properties
| C=20 | H=24 | O=10
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Apterin is a furanocoumarin and the glucoside of vaginol. It has been isolated from the root of plants in the family Apiaceae such as members of the genus Angelica, including the garden angelica and Zizia aptera.{{cite journal |author1=Lemmich, John |author2=Havelund, Svend |author3=Thastrup, Ole | journal = Phytochemistry | year = 1983 | volume = 22 | issue = 2 | pages = 553–5 | doi = 10.1016/0031-9422(83)83044-1 | title = Dihydrofurocoumarin glucosides from Angelica archangelica and Angelica silvestris}}{{cite journal | doi = 10.1016/0031-9422(74)85117-4| title = Apterin, an unusual glucoside of Zizia aptera| journal = Phytochemistry| volume = 13| issue = 9| pages = 1925–1927| year = 1974| last1 = Steck| first1 = Warren| last2 = Wetter| first2 = L.R.}}