aquayamycin

{{chembox

| verifiedrevid = 458036550

| ImageFile=Aquayamycin.svg

| ImageSize=150px

| PIN=(3R,4aR,12bS)-9-[(2R,4R,5S,6R)-4,5-Dihydroxy-6-methyloxan-2-yl]-3,4a,8,12b-tetrahydroxy-3-methyl-3,4,4a,12b-tetrahydrotetraphene-1,7,12(2H)-trione

| OtherNames=

| Reference=[https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=73441 Aquayamycin - Compound Summary], PubChem.

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=26055-63-0

| PubChem=73441

| SMILES=C[C@@H]1[C@H]([C@@H](C[C@@H](O1)C2=C(C3=C(C=C2)C(=O)C4=C(C3=O)C=C[C@]5([C@@]4(C(=O)C[C@](C5)(C)O)O)O)O)O)O

| MeSHName=aquayamycin

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 66147

| InChI = 1/C25H26O10/c1-10-19(28)14(26)7-15(35-10)11-3-4-12-17(20(11)29)21(30)13-5-6-24(33)9-23(2,32)8-16(27)25(24,34)18(13)22(12)31/h3-6,10,14-15,19,26,28-29,32-34H,7-9H2,1-2H3/t10-,14-,15-,19-,23+,24+,25+/m1/s1

| InChIKey = KCOULPRVOZDQEL-IFNZWHIZBY

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C25H26O10/c1-10-19(28)14(26)7-15(35-10)11-3-4-12-17(20(11)29)21(30)13-5-6-24(33)9-23(2,32)8-16(27)25(24,34)18(13)22(12)31/h3-6,10,14-15,19,26,28-29,32-34H,7-9H2,1-2H3/t10-,14-,15-,19-,23+,24+,25+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KCOULPRVOZDQEL-IFNZWHIZSA-N

}}

|Section2={{Chembox Properties

| Formula= C₂₅H₂₆O₁₀

| MolarMass= 486.47 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

Aquayamycin is an anthraquinone derivative.{{Cite journal | last1 = Sezaki | first1 = M. | last2 = Kondo | first2 = S. | last3 = Maeda | first3 = K. | last4 = Umezawa | first4 = H. | last5 = Ono | first5 = M. | title = The structure of aquayamycin | doi = 10.1016/S0040-4020(01)98726-5 | journal = Tetrahedron | volume = 26 | issue = 22 | pages = 5171–5190 | year = 1970 | pmid = 5499897}}

It is an inhibitor of the enzyme tyrosine hydroxylase.

Saquayamycins (saquayamycins A, B, C and D) are antibiotics of the aquayamycin group found in Streptomyces nodosus cultures broth.{{Cite journal

| doi = 10.7164/antibiotics.38.1171

| last1 = Uchida | first1 = T.

| last2 = Imoto | first2 = M.

| last3 = Watanabe | first3 = Y.

| last4 = Miura | first4 = K.

| last5 = Dobashi | first5 = T.

| last6 = Matsuda | first6 = N.

| last7 = Sawa | first7 = T.

| last8 = Naganawa | first8 = H.

| last9 = Hamada | first9 = M.