arboreol

{{chembox

| ImageFile = Arboreol acsv.svg

| ImageSize =

| IUPACName = (1R,4R,6aR)-1,4-Bis(1,3-benzodioxol-5-yl)dihydro-1H,3H-furo[3,4-c]furan-1,6a(6H)-diol

| OtherNames = (7β,7'α,8α,8'α)-3,4:3',4'-bis(methylenedioxy)-7,9':7',9-diepoxylignane-7,8-diol

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cite book |last1=Buckingham |first1=John |title=Dictionary of Natural Products |date=2 December 1993 |publisher=CRC Press |isbn=978-0-412-46620-5 |page=481 |url=https://books.google.com/books?id=1W0NUD42fA4C&dq=54868-71-2&pg=PA481 |language=en}}{{Cascite|changed|}}

| CASNo = 54868-71-2

| ChemSpiderID = 16737548

| PubChem = 101277405

| KEGG_Ref =

| KEGG =

| ChEMBL_Ref =

| ChEMBL =

| SMILES = O[C@@]43CO[C@H](C4CO[C@]3(O)c1ccc2OCOc2c1)c5ccc6OCOc6c5

| InChI=1S/C20H18O8/c21-19-8-23-18(11-1-3-14-16(5-11)26-9-24-14)13(19)7-28-20(19,22)12-2-4-15-17(6-12)27-10-25-15/h1-6,13,18,21-22H,7-10H2/t13-,18-,19-,20+/m1/s1

| InChIKey = WQZHIPWFEKLEJM-AQWZQNETSA-N

}}

|Section2={{Chembox Properties

| C=20 | H=18 | O=8

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Arboreol is an epoxylignan. Arboreol can be transformed by acid catalysis into gmelanone.{{cite journal | doi = 10.1016/S0040-4039(00)78645-X | title = Acid catalysed rearrangements of arboreol: A biomimetic synthesis of gmelanone | date = 1980 | last1 = Ramachandra Row | first1 = L. | last2 = Ventkateswarlu | first2 = Reveru | last3 = Pelter | first3 = Andrew | last4 = Ward | first4 = Robert S. | journal = Tetrahedron Letters | volume = 21 | issue = 30 | pages = 2919–2922 }}