arbutamine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 457138752
| IUPAC_name = 4-[(1R)-1-hydroxy-2-
| image = Arbutamine.svg
| width = 250
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 128470-16-6
| ATC_prefix = C01
| ATC_suffix = CA22
| PubChem = 60789
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01102
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54785
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = B07L15YAEV
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 50580
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201251
| C=18 | H=23 | N=1 | O=4
| smiles = Oc1ccc(cc1O)[C@@H](O)CNCCCCc2ccc(O)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H23NO4/c20-15-7-4-13(5-8-15)3-1-2-10-19-12-18(23)14-6-9-16(21)17(22)11-14/h4-9,11,18-23H,1-3,10,12H2/t18-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IIRWWTKISYTTBL-SFHVURJKSA-N
}}
Arbutamine is a cardiac stimulant. It stimulates β adrenergic receptors.{{cite journal | vauthors = Abou-Mohamed G, Nagarajan R, Ibrahim TM, Caldwell RW | title = Characterization of the adrenergic activity of arbutamine, a novel agent for pharmacological stress testing | journal = Cardiovascular Drugs and Therapy | volume = 10 | issue = 1 | pages = 39–47 | date = March 1996 | pmid = 8723169 | doi = 10.1007/BF00051129 | s2cid = 30315981 }}
References
{{reflist}}
{{Adrenergic agonists}}
{{Cardiac stimulants excluding cardiac glycosides}}
Category:Beta-adrenergic agonists
{{cardiovascular-drug-stub}}