arctiin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457138982

| ImageFile =Arctiin.svg

| ImageSize =250

| IUPACName =(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-{[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl}oxolan-2-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo =20362-31-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = TM5RQ949K7

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 388452

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C16915

| PubChem =100528

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 90827

| SMILES = O=C2OC[C@H](Cc1ccc(OC)c(OC)c1)[C@H]2Cc4ccc(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO)c(OC)c4

| InChI = 1/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1

| InChIKey = XOJVHLIYNSOZOO-SWOBOCGEBY

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XOJVHLIYNSOZOO-SWOBOCGESA-N

| MeSHName =arctigenin

}}

|Section2={{Chembox Properties

| C=27 | H=34 | O=11

| Appearance =

| Density =

| MeltingPtC = 110 to 112

| MeltingPt_notes =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Arctiin is a lignan found in many plants of the family Asteraceae, particularly the greater burdock (Arctium lappa) and Centaurea imperialis, and in Trachelospermum asiaticum, Saussurea heteromalla,{{cite journal |author=Arvind Saklani |author2=Manas Ranjan Sahoo|author3=Prabhu Dutt Mishra|author4=Ram Vishwakarma |title=Saussurea heteromalla (D. Don) Hand.-Mazz.: A new source of arctiin, arctigenin and chlorojanerin |journal=Indian Journal of Chemistry |publisher=NISCAIR-CSIR |location=India |year=2010 |volume=50B |pages=624 |issn=0975-0983 |url=http://nopr.niscair.res.in/bitstream/123456789/11408/1/IJCB%2050B%284%29%20624-626.pdf}} Retrieved on April 25, 2011. and Forsythia viridissima.{{cite book |author=David J. Triggle |author2=C. R. Ganellin|author3=F. MacDonald |title=Dictionary of Pharmacological Agents |publisher=Chapman & Hall/CRC |location=Boca Raton |year=1996 |volume=1 |pages=172 |isbn=0-412-46630-9 |url=https://books.google.com/books?id=DeX7jgInYFMC&q=arctiin&pg=RA1-PA172}} Retrieved on September 14, 2008 through Google Book Search. It is the glucoside of arctigenin.

Arctiin and arctigenin have shown anticancer effects in animal research.{{Citation needed|date=December 2015}} They have been found to act as agonists of the adiponectin receptor 1.{{cite journal | vauthors = Sun Y, Zang Z, Zhong L, Wu M, Su Q, Gao X, Zan W, Lin D, Zhao Y, Zhang Z | title = Identification of adiponectin receptor agonist utilizing a fluorescence polarization based high throughput assay | journal = PLOS ONE | volume = 8 | issue = 5 | pages = e63354 | year = 2013 | pmid = 23691032 | pmc = 3653934 | doi = 10.1371/journal.pone.0063354 | bibcode = 2013PLoSO...863354S | doi-access = free }}