arhalofenate

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Arhalofenate.svg

| width =

| alt =

| caption =

| image2 =

| width2 =

| alt2 =

| caption2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| captionLR =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 24136-23-0

| CAS_supplemental =

| PubChem = 12082259

| IUPHAR_ligand =

| DrugBank = DB11811

| ChemSpiderID = 28528987

| UNII = 1P01UJR9X1

| KEGG = D09579

| ChEBI =

| ChEMBL = 2103824

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 2-acetamidoethyl (2R)-2-(4-chlorophenyl)-2-[3-(trifluoromethyl)phenoxy]acetate

| C=19 | H=17 | Cl=1 | F=3 | N=1 | O=4

| molecular_weight =

| SMILES = CC(=O)NCCOC(=O)[C@@H](C1=CC=C(C=C1)Cl)OC2=CC=CC(=C2)C(F)(F)F

| Jmol =

| StdInChI = InChI=1S/C19H17ClF3NO4/c1-12(25)24-9-10-27-18(26)17(13-5-7-15(20)8-6-13)28-16-4-2-3-14(11-16)19(21,22)23/h2-8,11,17H,9-10H2,1H3,(H,24,25)/t17-/m1/s1

| StdInChI_comment =

| StdInChIKey = BJBCSGQLZQGGIQ-QGZVFWFLSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Arhalofenate is a dual-acting small molecule being developed by CymaBay Therapeutics for the treatment of gout, offering both urate-lowering and anti-inflammatory effects. As a uricosuric agent, arhalofenate lowers serum urate by inhibiting its reabsorption in the proximal tubules of the kidney through blockade of transporters such as URAT1, OAT4, and OAT10.{{cite journal | vauthors = Wang G, Zuo T, Li R | title = The mechanism of Arhalofenate in alleviating hyperuricemia-Activating PPARγ thereby reducing caspase-1 activity | journal = Drug Development Research | volume = 81 | issue = 7 | pages = 859–866 | date = November 2020 | pmid = 32506648 | doi = 10.1002/ddr.21699 | url = }} Arhalofenate also suppresses gout flares by inhibiting the urate crystal–stimulated release of interleukin-1β (IL-1β), the key cytokine responsible for triggering gout attacks.{{cite journal | vauthors = Yip K, Braverman G, Yue L, Fields T | title = Pipeline Therapies for Gout | journal = Current Rheumatology Reports | volume = 26 | issue = 3 | pages = 69–80 | date = March 2024 | pmid = 38133712 | doi = 10.1007/s11926-023-01128-3 | url = }}