arofylline

{{Chembox

| ImageFile = Arofylline.svg

| ImageSize = 150

| ImageAlt =

| IUPACName = 3-(4-Chlorophenyl)-1-propyl-7H-purine-2,6-dione

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 8028-93-1

| PubChem = 166553

| ChEMBL = 1598450

| ChemSpiderID = 145757

| SMILES = CCCN1C(=O)C2=C(N=CN2)N(C1=O)C3=CC=C(C=C3)Cl

}}

| Section2 = {{Chembox Properties

| Formula = C₁₄H₁₃ClN₄O₂

| MolarMass = 304.73 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Arofylline (codenamed LAS 31025) is a phosphodiesterase inhibitor.{{cite journal|pmid=10501583|year=1999|last1=Ferrer|first1=L|last2=Alberola|first2=J|last3=Queralt|first3=M|last4=Brazís|first4=P|last5=Rabanal|first5=R|last6=Llenas|first6=J|last7=Puigdemont|first7=A|title=Clinical anti-inflammatory efficacy of arofylline, a new selective phosphodiesterase-4 inhibitor, in dogs with atopic dermatitis|volume=145|issue=7|pages=191–4|journal=The Veterinary Record}}