arotinoid acid
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| image = Arotinoid acid.svg
| width =
| tradename =
| pregnancy_category =
| routes_of_administration =
| class =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 71441-28-6
| CAS_supplemental =
| PubChem = 5289501
| IUPHAR_ligand =
| DrugBank = DB02877
| ChemSpiderID =
| UNII = 673M8C29UR
| KEGG = C15634
| ChEBI = 75261
| ChEMBL = 275311
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
| IUPAC_name = 4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzoic acid
| C = 24 | H = 28 | O = 2
| SMILES = C/C(=C\C1=CC=C(C=C1)C(=O)O)/C2=CC3=C(C=C2)C(CCC3(C)C)(C)C
| StdInChI = 1S/C24H28O2/c1-16(14-17-6-8-18(9-7-17)22(25)26)19-10-11-20-21(15-19)24(4,5)13-12-23(20,2)3/h6-11,14-15H,12-13H2,1-5H3,(H,25,26)/b16-14+
| StdInChIKey = FOIVPCKZDPCJJY-JQIJEIRASA-N
}}
Arotinoid acid (TTNPB, Ro 13-7410) is an experimental drug which is a synthetic retinoid derivative. It was originally developed for potential medical applications in cancer treatment, but was not adopted due to potent teratogenic activity. However it has since been found to be useful as part of a cocktail of signalling factors used for cellular reprogramming in order to produce pluripotent stem cells.{{cite journal | vauthors = Pignatello MA, Kauffman FC, Levin AA | title = Multiple factors contribute to the toxicity of the aromatic retinoid TTNPB (Ro 13-7410): interactions with the retinoic acid receptors | journal = Toxicology and Applied Pharmacology | volume = 159 | issue = 2 | pages = 109–116 | date = September 1999 | doi = 10.1006/taap.1999.8726 | pmid = 10495774 | bibcode = 1999ToxAP.159..109P }}{{cite journal | vauthors = Hu Y, Yang Y, Tan P, Zhang Y, Han M, Yu J, Zhang X, Jia Z, Wang D, Yao K, Pang H, Hu Z, Li Y, Ma T, Liu K, Ding S | title = Induction of mouse totipotent stem cells by a defined chemical cocktail | journal = Nature | volume = 617 | issue = 7962 | pages = 792–797 | date = May 2023 | doi = 10.1038/s41586-022-04967-9 | pmid = 35728625 | bibcode = 2023Natur.617..792H }}{{cite journal | vauthors = Nath SC, Babaei-Abraki S, Meng G, Heale KA, Hsu CY, Rancourt DE | title = A retinoid analogue, TTNPB, promotes clonal expansion of human pluripotent stem cells by upregulating CLDN2 and HoxA1 | journal = Communications Biology | volume = 7 | issue = 1 | pages = 190 | date = February 2024 | doi = 10.1038/s42003-024-05812-7 | pmid = 38365890 | pmc = 10873380 }}
References
{{reflist}}
{{Retinoid receptor modulators}}