arprinocid

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 457153232

| IUPAC_name = 9-[(2-chloro-6-fluorophenyl)methyl]-6-purinamine

| image = arprinocid.png

| image2 = Arprinocid molecule ball.png

| alt2 = Ball-and-stick model of the arprinocid molecule

| width2 = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 55779-18-5

| ATCvet = yes

| ATC_prefix = P51

| ATC_suffix = AX11

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 321993

| PubChem = 41574

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6A0XTA8ZUH

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02987

| C=12 | H=9 | Cl=1 | F=1 | N=5

| smiles = C1=CC(=C(C(=C1)Cl)CN2C=NC3=C2N=CN=C3N)F

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 37936

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H9ClFN5/c13-8-2-1-3-9(14)7(8)4-19-6-18-10-11(15)16-5-17-12(10)19/h1-3,5-6H,4H2,(H2,15,16,17)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NAPNOSFRRMHNBJ-UHFFFAOYSA-N

}}

Arprinocid is a coccidiostat (or more likely a coccidiocide, i.e. a drug killing Coccidia parasites) used in veterinary medicine.{{cite journal | vauthors = McQuistion TE, McDougald LR | title = Anticoccidial activity of arprinocid and halofuginone | journal = Veterinary Parasitology | volume = 9 | issue = 1 | pages = 27–33 | date = October 1981 | pmid = 7201182 | doi = 10.1016/0304-4017(81)90004-2 }}