asoxime chloride

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 458471735

| IUPAC_name = 4-carbamoyl-1-[({2-[(E)-(hydroxyimino)methyl]pyridinium-1-yl}methoxy)methyl]pyridinium dichloride

| image = Asoxime chloride.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Experimental

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 34433-31-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HUV88P6SJS

| ATC_prefix = none

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 33051

| PubChem = 5484128

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 13004322

| C=14 | H=16 | N=4 | O=3 | Cl=2

| smiles = C1=CC=[N+](C(=C1)/C=N/O)COC[N+]2=CC=C(C=C2)C(=O)N.[Cl-].[Cl-]

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H14N4O3.2ClH/c15-14(19)12-4-7-17(8-5-12)10-21-11-18-6-2-1-3-13(18)9-16-20;;/h1-9H,10-11H2,(H-,15,19);2*1H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QELSIJXWEROXOE-UHFFFAOYSA-N

}}

Asoxime chloride, or more commonly HI-6, is a Hagedorn oxime used in the treatment of organophosphate poisoning.{{cite journal | vauthors = Cochran R, Kalisiak J, Küçükkilinç T, Radic Z, Garcia E, Zhang L, Ho KY, Amitai G, Kovarik Z, Fokin VV, Sharpless KB, Taylor P | display-authors = 6 | title = Oxime-assisted acetylcholinesterase catalytic scavengers of organophosphates that resist aging | journal = The Journal of Biological Chemistry | volume = 286 | issue = 34 | pages = 29718–24 | date = August 2011 | pmid = 21730071 | pmc = 3191013 | doi = 10.1074/jbc.M111.264739 | doi-access = free }}