avitriptan

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 458783204

| IUPAC_name = 1-[3-[3-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]propyl]-1H-indol-5-yl]-N-methyl-methanesulfonamide

| image = Avitriptan.png

| image2 = Avitriptan 3D BS.png

| tradename =

| pregnancy_category =

| legal_status = Never marketed

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 151140-96-4

| ATC_prefix = none

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2105880

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D03014

| PubChem = 133081

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 117442

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6RS056L04P

| C=22 | H=30 | N=6 | O=3 | S=1

| smiles = O=S(=O)(NC)Cc1ccc2c(c1)c(c[nH]2)CCCN4CCN(c3ncncc3OC)CC4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H30N6O3S/c1-23-32(29,30)15-17-5-6-20-19(12-17)18(13-25-20)4-3-7-27-8-10-28(11-9-27)22-21(31-2)14-24-16-26-22/h5-6,12-14,16,23,25H,3-4,7-11,15H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WRZVGHXUPBWIOO-UHFFFAOYSA-N

}}

Avitriptan (INN; development code BMS-180,048) is an antimigraine drug of the triptan family which was never marketed.{{cite journal|vauthors=Saxena PR, De Vries P, Wang W |title=Effects of avitriptan, a new 5-HT 1B/1D receptor agonist, in experimental models predictive of antimigraine activity and coronary side-effect potential |journal=Naunyn-Schmiedeberg's Archives of Pharmacology |volume=355 |issue=2 |pages=295–302 |date=February 1997 |pmid=9050026 |doi=10.1007/pl00004946 |url=http://link.springer.de/link/service/journals/00210/bibs/7355002/73550295.htm |display-authors=etal |url-status=dead |archiveurl=https://web.archive.org/web/19991023052058/http://link.springer.de/link/service/journals/00210/bibs/7355002/73550295.htm |archivedate=1999-10-23 |hdl=1765/66501 |s2cid=25137165 |hdl-access=free }} It acts as a 5-HT_1B and 5-HT_1D receptor agonist.