avizafone
{{Short description|Diazepam prodrug}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 444777910
| IUPAC_name = (2S)-2,6-diamino-N-
| image = Avizafone.svg
| width = 240
| tradename =
| legal_status =
| routes_of_administration = Intramuscular injection
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 65617-86-9
| ATC_prefix = none
| PubChem = 71968
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2103985
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 64974
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 65NK71K78P
| C=22 | H=27 | Cl=1 | N=4 | O=3
| smiles = Clc1cc(c(N(C(=O)CNC(=O)[C@@H](N)CCCCN)C)cc1)C(=O)c2ccccc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H27ClN4O3/c1-27(20(28)14-26-22(30)18(25)9-5-6-12-24)19-11-10-16(23)13-17(19)21(29)15-7-3-2-4-8-15/h2-4,7-8,10-11,13,18H,5-6,9,12,14,24-25H2,1H3,(H,26,30)/t18-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LTKOVYBBGBGKTA-SFHVURJKSA-N
}}
Avizafone{{cite patent | country = GB | number = 1517164 }} (Pro-Diazepam) is a water-soluble prodrug of the benzodiazepine derivative diazepam. It can be administered intramuscularly.
Avizafone is metabolised by enzymes in the blood to form the active drug diazepam. It is used mainly as an antidote to poisoning with organophosphate nerve agents.{{cite journal | vauthors = Karlsson B, Lindgren B, Millquist E, Sandberg M, Sellström A | title = On the use of diazepam and pro-diazepam (2-benzoyl-4-chloro-N-methyl-N-lysylglycin anilide), as adjunct antidotes in the treatment of organophosphorus intoxication in the guinea-pig | journal = The Journal of Pharmacy and Pharmacology | volume = 42 | issue = 4 | pages = 247–51 | date = April 1990 | pmid = 1974291 | doi = 10.1111/j.2042-7158.1990.tb05401.x | s2cid = 32369013 }}{{cite journal | vauthors = Lallement G, Renault F, Baubichon D, Peoc'h M, Burckhart MF, Galonnier M, Clarençon D, Jourdil N | display-authors = 6 | title = Compared efficacy of diazepam or avizafone to prevent soman-induced electroencephalographic disturbances and neuropathology in primates: relationship to plasmatic benzodiazepine pharmacokinetics | journal = Archives of Toxicology | volume = 74 | issue = 8 | pages = 480–6 | date = October 2000 | pmid = 11097386 | doi = 10.1007/s002040000146 | s2cid = 22292597 }}{{cite journal | vauthors = Taysse L, Calvet JH, Buée J, Christin D, Delamanche S, Breton P | title = Comparative efficacy of diazepam and avizafone against sarin-induced neuropathology and respiratory failure in guinea pigs: influence of atropine dose | journal = Toxicology | volume = 188 | issue = 2–3 | pages = 197–209 | date = June 2003 | pmid = 12767691 | doi = 10.1016/s0300-483x(03)00086-6 }}
See also
References
{{Reflist|2}}
{{Benzodiazepines}}
{{GABAAR PAMs}}
Category:GABAA receptor positive allosteric modulators
Category:Benzodiazepine prodrugs
{{nervous-system-drug-stub}}