balovaptan

{{Short description|Chemical compound}}

{{Use dmy dates|date=November 2019}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| image = Balovaptan.svg

| width = 200

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| DailyMedID =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration =

| class =

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number_Ref =

| CAS_number = 1228088-30-9

| CAS_supplemental =

| PubChem = 46200932

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank = DB14823

| ChemSpiderID_Ref =

| ChemSpiderID = 59718648

| UNII = RAX5D5AGV6

| KEGG = D11476

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = RG7314

| IUPAC_name = 8-Chloro-5-methyl-1-(4-pyridin-2-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine

| C = 22

| H = 24

| Cl = 1

| N = 5

| O = 1

| SMILES = CN1CC2=NN=C([C@H]3CC[C@@H](CC3)OC3=CC=CC=N3)N2C2=C(C1)C=C(Cl)C=C2

| StdInChI_Ref =

| StdInChI = 1S/C22H24ClN5O/c1-27-13-16-12-17(23)7-10-19(16)28-20(14-27)25-26-22(28)15-5-8-18(9-6-15)29-21-4-2-3-11-24-21/h2-4,7,10-12,15,18H,5-6,8-9,13-14H2,1H3/t15-,18-

| StdInChI_comment =

| StdInChIKey_Ref =

| StdInChIKey = GMPZPHGHNDMRKL-RZDIXWSQSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Balovaptan ({{abbrlink|INN|International Nonproprietary Name}}; developmental code name RG7314), is a selective small molecule antagonist of the vasopressin V1A receptor which is under development by Roche for the treatment of post-traumatic stress disorder (PTSD).{{cite web | url = http://www.roche.com/research_and_development/who_we_are_how_we_work/pipeline.htm | title = Roche - Pipeline | year = 2023 | access-date = 2023-04-05}}

Research

= Post-traumatic stress disorder =

It was in a phase III clinical trial for adults and a phase II clinical trial for children for post-traumatic stress disorder.{{ClinicalTrialsGov|NCT01793441|Study of RG7314 to Investigate Efficacy and Safety in Individuals With Autism Spectrum Disorders}}

= Autism =

In January 2018, Roche announced that the US Food and Drug Administration (FDA) had granted breakthrough therapy designation for balovaptan in people with autism spectrum disorder (ASD).{{cite press release |url= https://www.roche.com/investors/updates/inv-update-2018-01-29.htm|title= FDA grants Breakthrough Therapy Designation for Roche's balovaptan in autism spectrum disorder|author= |date=2018-01-29 |access-date=2018-02-06}} The FDA granted this based on the results of the adult phase II clinical trial called VANILLA (Vasopressin ANtagonist to Improve sociaL communication in Autism) study.{{cite journal | vauthors = Bolognani F, Del Valle Rubido M, Squassante L, Wandel C, Derks M, Murtagh L, Sevigny J, Khwaja O, Umbricht D, Fontoura P | title = A phase 2 clinical trial of a vasopressin V1a receptor antagonist shows improved adaptive behaviors in men with autism spectrum disorder | journal = Science Translational Medicine | volume = 11 | issue = 491 | date = May 2019 | pmid = 31043521 | doi = 10.1126/scitranslmed.aat7838 | doi-access = free }}

The phase III study concluded that balovaptan did not improve social communication in autistic adults.{{cite journal | vauthors = Jacob S, Veenstra-VanderWeele J, Murphy D, McCracken J, Smith J, Sanders K, Meyenberg C, Wiese T, Deol-Bhullar G, Wandel C, Ashford E, Anagnostou E | title = Efficacy and safety of balovaptan for socialisation and communication difficulties in autistic adults in North America and Europe: a phase 3, randomised, placebo-controlled trial | journal = The Lancet. Psychiatry | volume = 9 | issue = 3 | pages = 199–210 | date = March 2022 | pmid = 35151410 | doi = 10.1016/s2215-0366(21)00429-6 }}

= Stroke =

It was also in phase II studies for the treatment of stroke. However, it has since been discontinued for both of those indications.{{cite web|url=https://adis.springer.com/drugs/800035102 |title=Balovaptan | work = Adis Insight | publisher = Springer Nature Switzerland AG |access-date=2023-04-05}}

References

{{Reflist}}

{{Oxytocin and vasopressin receptor modulators}}

{{Benzodiazepines}}

{{Portal bar | Medicine }}

Category:Chloroarenes

Category:Experimental psychiatric drugs

Category:2-Pyridyl compounds

Category:Triazoles

Category:Vasopressin receptor antagonists