bamifylline
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 459517599
| ImageFile = Bamifylline.svg
| ImageAlt = Skeletal formula of bamifylline
| ImageFile1 = Bamifylline 3D spacefill.png
| ImageAlt1 = Space-filling model of the bamifylline molecule
| PIN = 8-Benzyl-7-{2-[ethyl(2-hydroxyethyl)amino]ethyl}-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
| OtherNames =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 15401
| CASNo_Ref = {{cascite|changed|??}}
| CASNo=2016-63-9
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2110760
| PubChem=16229
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZTY15D026H
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H27N5O3/c1-4-24(12-13-26)10-11-25-16(14-15-8-6-5-7-9-15)21-18-17(25)19(27)23(3)20(28)22(18)2/h5-9,26H,4,10-14H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VVUYEFBRTFASAH-UHFFFAOYSA-N
| SMILES = O=C2N(c1nc(n(c1C(=O)N2C)CCN(CC)CCO)Cc3ccccc3)C
}}
| Section2 = {{Chembox Properties
| Formula = C20H27N5O3
| MolarMass = 385.46008
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section6 = {{Chembox Pharmacology
| ATCCode_prefix = R03
| ATCCode_suffix = DA08
}}
| Section7 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Bamifylline is a drug of the xanthine chemical class which acts as a selective adenosine A1 receptor antagonist.{{cite journal | last1 = Tomai | first1 = F | last2 = Crea | first2 = F | last3 = Gaspardone | first3 = A | last4 = Versaci | first4 = F | last5 = De Paulis | first5 = R | last6 = Polisca | first6 = P | last7 = Chiariello | first7 = L | last8 = Gioffrè | first8 = PA | title = Effects of A1 adenosine receptor blockade by bamiphylline on ischaemic preconditioning during coronary angioplasty | journal = European Heart Journal | date = June 1996 | volume = 17 | issue = 6 | pages = 846–53 | pmid = 8781823 | doi=10.1093/oxfordjournals.eurheartj.a014965| doi-access = free }}{{cite journal | last1 = Kofman | first1 = J | last2 = Grosclaude | first2 = M | last3 = Ouechni | first3 = MM | last4 = Perrin-Fayolle | first4 = M | title = Comparative effects of bamifylline and theophylline on allergenic bronchospasm induced by the provocative inhalation test: double-blind cross-over study | journal = Le Poumon et le Coeur | year = 1982 | volume = 38 | issue = 3 | pages = 197–202 | pmid = 6752929 | language = French}}
See also
References
{{Reflist}}
{{Drugs for obstructive airway diseases}}
{{Adenosinergics}}
Category:Adenosine receptor antagonists
Category:Hydroxyethyl compounds
{{respiratory-system-drug-stub}}
{{cardiovascular-drug-stub}}