barium acetate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| Reference=[http://hazard.com/msds/mf/baker/baker/files/b0336.htm], JT Baker

| verifiedrevid = 449115784

| ImageFile = Barium acetate.png

| IUPACName = Barium acetate

| OtherNames = Barium diacetate

| Section1 = {{Chembox Identifiers

| Abbreviations = Ba(OAc)₂

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10515

| ChEBI = 190441

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = FBA31YJ60R

| InChI = 1/2C2H4O2.Ba/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2

| InChIKey = ITHZDDVSAWDQPZ-NUQVWONBAA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2C2H4O2.Ba/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ITHZDDVSAWDQPZ-UHFFFAOYSA-L

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 543-80-6

| PubChem = 10980

| EINECS = 208-849-0

| SMILES = [Ba+2].[O-]C(=O)C.[O-]C(=O)C

| RTECS = AF4550000

}}

| Section2 = {{Chembox Properties

| C=4|H=6|Ba=1|O=4

| Appearance = White solid

| Odor = odorless

| Density = 2.468 g/cm³ (anhydrous)
2.19 g/cm³ (monohydrate)

| MeltingPtC = 450

| MeltingPt_notes = decomposes

| BoilingPt =

| Solubility = 55.8 g/100 mL (0 °C)
72 g/100mL (20 °C)

| SolubleOther = slightly soluble in ethanol, methanol

| MagSus = −100.1·10⁻⁶ cm³/mol (·2H₂O)

}}

| Section7 = {{Chembox Structure

| CrystalStruct = tetragonal

}}

| Section8 = {{Chembox Hazards

| MainHazards = Toxic, hazardous on ingestion

| FlashPt =

| NFPA-H = 3

| NFPA-F = 0

| NFPA-R = 0

| NFPA-S =

| AutoignitionPt =

| LD50 = 108 mg/kg (oral, rat)

}}

Barium acetate (Ba(C₂H₃O₂)₂) is the salt of barium(II) and acetic acid. Barium acetate is toxic to humans, but it has use in chemistry and manufacturing.

Preparation

Barium acetate is generally produced by the reaction of acetic acid with barium carbonate:[http://www.hillakomem.com/barium-acetate.html Barium acetate] {{webarchive |url=https://web.archive.org/web/20090628101300/http://www.hillakomem.com/barium-acetate.html |date=June 28, 2009 }}, hillakomem.com, retrieved 30 June 2009

:BaCO₃ + 2{{hsp}}CH₃COOH → (CH₃COO)₂Ba + CO₂ + H₂O

The reaction is performed in solution and the barium acetate crystalizes out at temperatures above 41 °C. Between 25 and 40 °C, the monohydrate version crystalizes. Alternatively, barium sulfide can be used:

:BaS + 2{{hsp}}CH₃COOH → (CH₃COO)₂Ba + H₂S

Again, the solvent is evaporated off and the barium acetate crystallized.

Properties

Barium acetate is a white powder, which is highly soluble: at 0 °C, 55.8 g of barium acetate can be dissolved in 100 g of water. It decomposes upon heating into barium carbonate.{{citation needed|date=December 2011}}

Reactions

When heated in air, barium acetate decomposes to the carbonate. It reacts with acids: reaction with sulfuric acid, hydrochloric acid and nitric acid give the sulfate, chloride and nitrate respectively.{{citation needed|date=July 2019}}

Uses

Barium acetate is used as a mordant for printing textile fabrics, for drying paints and varnishes and in lubricating oil. In chemistry, it is used in the preparation of other acetates; and as a catalyst in organic synthesis.{{citation needed|date=July 2019}}

In popular culture

Barium acetate was featured in a 2001 episode of the television series Forensic Files, recounting the 1993 murder of a man by his teenage daughter (Marie Robards), though the episode and other crime documentary shows examining the Robards case excluded mention of the name of the chemical.

Barium acetate was featured in a 2014 episode of the crime documentary series Redrum.

Barium acetate was named as the choice poison of a teen's murder of her father in an episode of Deadly Women.{{citation needed|date=July 2019}}