barium hexafluorosilicate

{{Chembox

| Name = Barium hexafluorosilicate

| ImageFile = Barium ion File:Hexafluorosilicat-Ion.svg

| ImageSize =

| ImageAlt =

| IUPACName = barium(2+);hexafluorosilicon(2-)

| OtherNames = Barium silicofluoride, bariumsilicofluorid

| Section1 = {{Chembox Identifiers

| CASNo = 17125-80-3

| ChemSpiderID = 26327

| UNII = W4A72RWE6Q

| DTXSID = DTXSID80884961

| EINECS = 241-189-1

| PubChem = 28299

| StdInChI = 1S/Ba.F6Si/c;1-7(2,3,4,5)6/q+2;-2

| StdInChIKey = RRLMRHFZRPYSNK-UHFFFAOYSA-N

| SMILES = F[Si-2](F)(F)(F)(F)F.[Ba+2]

}}

| Section2 = {{Chembox Properties

| Ba=1|Si=1|F=6

| MolarMass =

| Appearance = White crystalline powder

| Density = 4.279 g/cm3{{cite book |last1=Koch |first1=Ernst-Christian |title=High Explosives, Propellants, Pyrotechnics |date=18 January 2021 |publisher=Walter de Gruyter GmbH & Co KG |isbn=978-3-11-066056-2 |page=86 |url=https://books.google.com/books?id=ZOsUEAAAQBAJ&dq=Barium+hexafluorosilicate&pg=PA86 |access-date=18 June 2024 |language=en}}

| MeltingPt = 1580

| BoilingPt =

| Solubility = poorly soluble

}}

| Section3 = {{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| GHS_ref = {{cite web |title=Barium hexafluorosilicate |url=https://pubchem.ncbi.nlm.nih.gov/compound/28299#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| HPhrases = {{H-phrases|302|332}}

| PPhrases = {{P-phrases|261|264|270|271|301+317|304+340|317|330|501}}

| MainHazards =

}}

}}

Barium hexafluorosilicate is an inorganic chemical compound with the chemical formula {{chem2|BaSiF6}}.{{cite web |title=Barium Fluorosilicate |url=https://www.americanelements.com/barium-fluorosilicate-17125-80-3 |publisher=American Elements |access-date=18 June 2024 |language=en}}{{cite web |title=Barium hexafluorosilicate |url=https://www.sigmaaldrich.com/RU/en/product/aldrich/433381 |publisher=Sigma Aldrich |access-date=18 June 2024}}{{cite book |last1=Milne |first1=G. W. A. |title=Gardner's Commercially Important Chemicals: Synonyms, Trade Names, and Properties |date=2 September 2005 |publisher=John Wiley & Sons |isbn=978-0-471-73661-5 |page=52 |url=https://books.google.com/books?id=oWdc2qcb3QsC&dq=Barium+hexafluorosilicate&pg=PA52 |access-date=18 June 2024 |language=en}}

Synthesis

As a salt that is poorly soluble in water, barium hexafluorosilicate precipitates from solutions that contain barium ions (e.g. barium chloride as well as hexafluorosilicate ions (e.g. hexafluorosilicic acid).{{cite book |title=Inorganic Syntheses, Volume 4 |date=22 September 2009 |publisher=John Wiley & Sons |isbn=978-0-470-13267-8 |page=145 |url=https://books.google.com/books?id=sOSvnJmXh1cC&dq=Barium+hexafluorosilicate&pg=PA145 |access-date=18 June 2024 |language=en}}

:{{chem2|BaCl2 + H2[SiF6] → Ba[SiF6] + 2HCl}}

Uses

The compound is used as a chemical reagent in experimental applications. In various chemical reactions and processes, the compound acts as a source of barium and hexafluorosilicate ions.{{cite web |title=Barium hexafluorosilicate {{!}} CAS 17125-80-3 {{!}} SCBT - Santa Cruz Biotechnology |url=https://www.scbt.com/p/barium-hexafluorosilicate-17125-80-3 |publisher=Santa Cruz Biotechnology |access-date=18 June 2024 |language=en}}

It was also used as an insecticide.{{cite book |title=Harmonized commodity description and coding system: explanatory notes |date=1986 |publisher=U.S. Department of the Treasury, Customs Service |page=270 |url=https://books.google.com/books?id=PaKWbNAL9-gC&dq=Barium+hexafluorosilicate&pg=PA270 |access-date=18 June 2024 |language=en}}

References

{{barium compounds}}

{{fluorine compounds}}

Category:Barium compounds

Category:Hexafluorosilicates