barnidipine

{{Short description|Antihypertensive drug of the calcium channel blocker class}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 459522276

| IUPAC_name = 3-(3R)-1-Benzylpyrrolidin-3-yl 5-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate

| image = Barnidipine structure.svg

| width = 250

| tradename =

| Drugs.com = {{drugs.com|international|barnidipine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 104713-75-9

| ATC_prefix = C08

| ATC_suffix = CA12

| ATC_supplemental =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2103761

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2VBY96ASWJ

| PubChem = 443869

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 391959

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C27H29N3O6/c1-17-23(26(31)35-3)25(20-10-7-11-21(14-20)30(33)34)24(18(2)28-17)27(32)36-22-12-13-29(16-22)15-19-8-5-4-6-9-19/h4-11,14,22,25,28H,12-13,15-16H2,1-3H3/t22-,25-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VXMOONUMYLCFJD-DHLKQENFSA-N

| C=27 | H=29 | N=3 | O=6

| smiles = [O-][N+](=O)c1cccc(c1)[C@H]4C(/C(=O)OC)=C(\N\C(=C4\C(=O)O[C@H]3CCN(Cc2ccccc2)C3)C)C

}}

Barnidipine (INN; also known as mepirodipine) is a calcium channel blocker which belongs to the dihydropyridine (DHP) group of calcium channel blockers. It is used in the treatment of hypertension.{{PubChem|443869}}

Pharmacodynamics

Barnidipine is a pure S,S isomer, a lipophilic 1,4-dihydropyridine calcium channel blocker, which, like other compounds in the class, shows a high affinity for calcium channels, particularly the L-type slow channels of smooth muscle cells found in the vessel wall.{{cite journal | vauthors = van Zwieten PA | title = Pharmacological profile of barnidipine: a single optical isomer dihydropyridine calcium antagonist | journal = Blood Pressure. Supplement | volume = 1 | pages = 5–8 | date = 1998 | pmid = 9660520 }} Calcium channel blocking drugs have the characteristic of interfering with the flow of calcium ions into the interior of cells through the slow channels of the plasma membrane.

References