batelapine

{{Short description|Chemical compound}}

{{One source|date=April 2021}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 2-methyl-5-(4-methylpiperazin-1-yl)-11H-[1,2,4]triazolo[1,5-c][1,3]benzodiazepine

| image = Batelapine.svg

| width = 200

| tradename =

| routes_of_administration = By mouth

| bioavailability =

| metabolism =

| elimination_half-life = 8.1 Hours

| IUPHAR_ligand =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 95634-82-5

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| PubChem = 60717

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 6721

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = P71TE299SG

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2110765

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG =

| synonyms = CGS-13429

| C=16 | H=20 | N=6

| smiles = CC1=NN2C(=N1)CC3=CC=CC=C3N=C2N4CCN(CC4)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H20N6/c1-12-17-15-11-13-5-3-4-6-14(13)18-16(22(15)19-12)21-9-7-20(2)8-10-21/h3-6H,7-11H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PUHMYHQVPODHCZ-UHFFFAOYSA-N

}}

Batelapine (developmental code name CGS-13429) is a structural analogue of clozapine which was investigated as a potential antipsychotic.{{cite journal | vauthors = Chovan JP, Vermeulen JD | title = High-performance liquid chromatographic method for a clozapine analogue, CGS 13429, and its N-oxide and desmethyl metabolites | journal = Journal of Chromatography | volume = 494 | pages = 413–9 | date = September 1989 | pmid = 2573611 | doi = 10.1016/s0378-4347(00)82697-3 }}{{Cite web|url=https://adisinsight.springer.com/drugs/800007160|title=Batelapine - AdisInsight}}