becampanel

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = ({[(2,3-Dihydroxy-7-nitro-5-quinoxalinyl)methyl]amino}methyl)phosphonic acid

| image = Becampanel.svg

| CAS_number = 188696-80-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = X3D0O800AJ

| ATC_prefix = None

| ATC_suffix =

| PubChem = 5491960

| DrugBank =

| ChemSpiderID = 4590791

| chemical_formula =

| C=10 | H=11 | N=4 | O=7 | P=1

| smiles = c1c(cc2c(c1CNCP(=O)(O)O)[nH]c(=O)c(=O)[nH]2)[N+](=O)[O-]

| StdInChI = 1S/C10H11N4O7P/c15-9-10(16)13-8-5(3-11-4-22(19,20)21)1-6(14(17)18)2-7(8)12-9/h1-2,11H,3-4H2,(H,12,15)(H,13,16)(H2,19,20,21)

| StdInChIKey = ABFMMCZFKUIJGQ-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Becampanel (INN; development code AMP397) is a quinoxalinedione derivative drug which acts as a competitive antagonist of the AMPA receptor (IC₅₀ = 11 nM).{{cite book| vauthors = Taylor JB, Triggle DJ |title=Comprehensive medicinal chemistry II|url=https://books.google.com/books?id=fIMvAQAAIAAJ|year=2007|publisher=Elsevier|isbn=978-0-08-044513-7|page=290}}{{cite journal | vauthors = Kwan P, Brodie MJ | title = Emerging drugs for epilepsy | journal = Expert Opinion on Emerging Drugs | volume = 12 | issue = 3 | pages = 407–422 | date = September 2007 | pmid = 17874969 | doi = 10.1517/14728214.12.3.407 | s2cid = 27627114 }}{{cite journal | vauthors = Citraro R, Aiello R, Franco V, De Sarro G, Russo E | title = Targeting α-amino-3-hydroxyl-5-methyl-4-isoxazole-propionate receptors in epilepsy | journal = Expert Opinion on Therapeutic Targets | volume = 18 | issue = 3 | pages = 319–334 | date = March 2014 | pmid = 24387310 | doi = 10.1517/14728222.2014.874416 | s2cid = 1504490 }}{{cite book|author=World Health Organization|title=International Nonproprietary Names (INN) for Pharmaceutical Substances|url=https://books.google.com/books?id=dcF1nQEACAAJ|year=1988|publisher=W.H.O.|isbn=9789240560369}} It was investigated as an anticonvulsant for the treatment of epilepsy by Novartis, and was also looked at as a potential treatment for neuropathic pain and cerebral ischemia, but never completed clinical trials.{{cite journal | vauthors = Pathan SA, Jain GK, Akhter S, Vohora D, Ahmad FJ, Khar RK | title = Insights into the novel three 'D's of epilepsy treatment: drugs, delivery systems and devices | journal = Drug Discovery Today | volume = 15 | issue = 17–18 | pages = 717–732 | date = September 2010 | pmid = 20603226 | doi = 10.1016/j.drudis.2010.06.014 }}