benazepril

{{Short description|Medication used to treat high blood pressure and heart failure}}

{{Use dmy dates|date=October 2022}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| verifiedrevid = 459529583

| image = Benazepril structure.svg

| alt =

| caption =

| image2 = Benazepril-3D-balls.png

| alt2 =

| pronounce = {{IPAc-en|b|ə|ˈ|n|æ|z|ə|p|r|ɪ|l}}

| tradename = Lotensin, others

| Drugs.com = {{drugs.com|monograph|benazepril-hydrochloride}}

| MedlinePlus = a692011

| DailyMedID = Benazepril

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = By mouth

| class =

| ATC_prefix = C09

| ATC_suffix = AA07

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Lotensin- benazepril hydrochloride tablet | website=DailyMed | date=21 January 2019 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=2abb091b-a53e-46b0-9b84-e5ee8f2bdd8e | access-date=11 February 2024}}

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Rx-only

| bioavailability =

| protein_bound = 96.7%

| metabolism = Liver glucuronidation

| metabolites =

| onset =

| elimination_half-life = 10-11 hours

| duration_of_action =

| excretion = Kidney and bile duct

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 86541-75-5

| CAS_supplemental =

| PubChem = 5362124

| IUPHAR_ligand = 6374

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00542

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4514935

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UDM7Q7QWP8

| KEGG = D07499

| KEGG2 = D00620

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3011

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 838

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 2-[(3S)-3-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid

| C = 24

| H = 28

| N = 2

| O = 5

| SMILES = O=C(OCC)[C@@H](N[C@@H]2C(=O)N(c1ccccc1CC2)CC(=O)O)CCc3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28)/t19-,20-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI_comment =

| StdInChIKey = XPCFTKFZXHTYIP-PMACEKPBSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Benazepril, sold under the brand name Lotensin among others, is a medication used to treat high blood pressure, heart failure, and diabetic kidney disease. It is a reasonable initial treatment for high blood pressure. It is taken by mouth. Versions are available as the combinations benazepril/hydrochlorothiazide and benazepril/amlodipine.

Common side effects include feeling tired, dizziness, cough, and light-headedness with standing. Serious side effects may include kidney problems, low blood pressure, high blood potassium, and angioedema. Use in pregnancy may harm the baby, while use when breastfeeding may be safe.{{cite web |title=Benazepril Pregnancy and Breastfeeding Warnings |url=https://www.drugs.com/pregnancy/benazepril.html |website=Drugs.com |access-date=3 March 2019 }} It is an ACE inhibitor and works by decreasing renin-angiotensin-aldosterone system activity.{{cite web |title=Benazepril Hydrochloride Monograph for Professionals |url=https://www.drugs.com/monograph/benazepril-hydrochloride.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |access-date=3 March 2019 }}

Benazepril was patented in 1981 and came into medical use in 1990. It is available as a generic medication. In 2022, it was the 159th most commonly prescribed medication in the United States, with more than 3{{nbsp}}million prescriptions.{{cite web | title=The Top 300 of 2022 | url=https://clincalc.com/DrugStats/Top300Drugs.aspx | website=ClinCalc | access-date=30 August 2024 | archive-date=30 August 2024 | archive-url=https://web.archive.org/web/20240830202410/https://clincalc.com/DrugStats/Top300Drugs.aspx | url-status=live }}{{cite web | title = Benazepril Drug Usage Statistics, United States, 2013 - 2022 | website = ClinCalc | url = https://clincalc.com/DrugStats/Drugs/Benazepril | access-date = 30 August 2024 }}