benexate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 459532473

| IUPAC_name = Phenylmethyl 2-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxybenzoate

| image = Benexate.svg

| tradename =

| Drugs.com = {{drugs.com|international|benexate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 78718-52-2

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| ChEMBL = CHEMBL2104696

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H27N3O4/c24-23(25)26-14-16-10-12-18(13-11-16)21(27)30-20-9-5-4-8-19(20)22(28)29-15-17-6-2-1-3-7-17/h1-9,16,18H,10-15H2,(H4,24,25,26)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = IAXUQWSLRKIRFR-UHFFFAOYSA-N

| PubChem = 2316

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2226

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O3PR2X907M

| C=23 | H=27 | N=3 | O=4

| smiles = O=C(OCc1ccccc1)c3ccccc3OC(=O)C2CCC(C/N=C(\N)N)CC2

}}

Benexate (BEX) is an anti-ulcer agent used in the treatment of acid-related disorders. It is unique in its inability to form salts that are both non-bitter and soluble.{{cite journal | vauthors = Hori Y, Odaguchi K, Jyoyama H, Yasui K, Mizui T | title = Differential effect of benexate hydrochloride betadex on prostaglandin levels in stomach and inflammatory sites in rats | journal = Japanese Journal of Pharmacology| issue = 2 | pages = 183–190 | date = 1996| volume = 72 | pmid = 8912919| doi = 10.1254/jjp.72.183 | doi-access = free }}{{cite journal | vauthors = Muranushi N, Yoshida M, Kinoshita H, Hirose F, Fukuda T, Doteuchi M, Yamada H | title = Studies of benexate CD: effect of inclusion compound formation on the antiulcer activity of benexate, the effective ingredient of benexate CD. | journal = Folia Pharmacologica Japonica | issue = 91| pages = 377–383 | date = 1998 }}