benmoxin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 459533229

| IUPAC_name = N'-(1-phenylethyl)benzohydrazide

| image = Benmoxin.svg

| tradename =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 7654-03-7

| ATC_prefix = None

| ATC_suffix =

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H16N2O/c1-12(13-8-4-2-5-9-13)16-17-15(18)14-10-6-3-7-11-14/h2-12,16H,1H3,(H,17,18)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BEWNZPMDJIGBED-UHFFFAOYSA-N

| PubChem = 71671

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1877495

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 64728

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XC9FY2SGBG

| C=15 | H=16 | N=2 | O=1

| smiles = O=C(NNC(c1ccccc1)C)c2ccccc2

}}

Benmoxin (trade names Neuralex, Nerusil), also known as mebamoxine, is an irreversible and nonselective monoamine oxidase inhibitor (MAOI) of the hydrazine class.{{cite book | title = Dictionary of Pharmacological Agents | volume = 1—2 | vauthors = Ganellin CR, Triggle DJ | year = 1996 | publisher = Chapman & Hall | isbn = 0-9630096-0-5 | page = 229 | url = https://books.google.com/books?id=DeX7jgInYFMC&pg=PA229}}{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=benmoxin&pg=PA101}} It was synthesized in 1967 and was subsequently used as an antidepressant in Europe, but is now no longer marketed.