benthiocarb

{{Chembox

| Watchedfields = changed

| verifiedrevid = 459858663

| ImageFile = Benthiocarb.svg

| ImageSize =

| PIN = S-[(4-Chlorophenyl)methyl] diethylcarbamothioate

| OtherNames = Thiobencarb, Saturn, Bolero

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 28249-77-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 90LN6Y7I7H

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 388559

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QHTQREMOGMZHJV-UHFFFAOYSA-N

| PubChem = 34192

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 31512

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C14428

| SMILES = Clc1ccc(cc1)CSC(=O)N(CC)CC

| InChI =1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3

}}

|Section2={{Chembox Properties

| C=12 | H=16 | Cl=1 | N=1 | O=1 | S=1

| Appearance = Pale yellow to brownish-yellow liquid

| Density = 1.145-1.180 g cm⁻³ at 20 °C

| MeltingPtC = 3.3

| MeltingPt_notes =

| BoilingPtC = 126 to 129

| BoilingPt_notes = at 0.008 Torr

| Solubility = 28.0 mg/L at 25 °C

| SolubleOther = Readily soluble in: acetone, ethanol, xylene, methanol, benzene, n-hexane, and acetonitrile

| LogP =3.42 (octanol/water){{cite book | editor = Tomlin, C.D.S. | title = The Pesticide Manual - World Compendium | edition = 11th | publisher = British Crop Protection Council | location = Surrey, England | date = 1997 | page = 1192 }}

}}

|Section3={{Chembox Hazards

| NFPA-H = 4

| NFPA-F = 1

| NFPA-R = 0

| NFPA-S =

| MainHazards =

| LD50 = Rat, oral 1300 mg/kg

Mouse, oral 560 mg/kg {{cite book | editor = Worthing, C.R. and S.B. Walker | title = The Pesticide Manual - A World Compendium | edition = 8th | location = Thornton Heath, UK | publisher = The British Crop Protection Council | date = 1987 | page = 796}}

| FlashPtC = 165.8

| AutoignitionPtC =

}}

}}

Benthiocarb is a thiocarbamate cholinesterase inhibitor used as an herbicide. Benthiocarb is almost always used to control the weeds around rice crops, but its effectiveness is not specific to just rice crops.{{Cite web |last=United States Environmental Protection Agency |date=September 1997 |title=R.E.D. FACTS Thiobencarb |url=https://www3.epa.gov/pesticides/chem_search/reg_actions/reregistration/fs_PC-108401_1-Sep-97.pdf |access-date=September 26, 2022}} The benthiocarb molecule is an organic molecule containing a phenol bonded to a chlorine atom.

File:Rice crops at initial stage.jpg