bevonium

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460322168

| IUPAC_name = 2-[(2-hydroxy-2,2-diphenylacetoxy)methyl]-1,1-dimethylpiperidinium

| image = Bevonium.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 33371-53-8

| ATC_prefix = A03

| ATC_suffix = AB13

| PubChem = 31800

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1882461

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 34B0471E08

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 29489

| smiles = O=C(OCC1[N+](C)(C)CCCC1)C(O)(c2ccccc2)c3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H28NO3/c1-23(2)16-10-9-15-20(23)17-26-21(24)22(25,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,20,25H,9-10,15-17H2,1-2H3/q+1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UHUMRJKDOOEQIG-UHFFFAOYSA-N

| C=22 | H=28 | N=1 | O=3 | charge = +

}}

Bevonium (piribenzil) is an antimuscarinic{{Cite web|title=KEGG DRUG: Bevonium methylsulfate|url=https://www.genome.jp/entry/D01532|access-date=2021-09-11|website=www.genome.jp}}{{Cite web|title=Bevonium - Side Effects, Uses, Dosage, Overdose, Pregnancy, Alcohol | work = RxWiki | date = 8 November 2013 |url=https://www.rxwiki.com/bevonium/|access-date=2021-09-11 }} with antispasmodic and bronchodilating properties.{{cite book | vauthors = Milne GW |title=Drugs synonyms and properties |date=May 2018 |publisher=Routledge |location=London |isbn=978-1-351-78989-9 | chapter = Entry 2677: Bevonium | chapter-url=https://books.google.com/books?id=xUlaDwAAQBAJ&pg=PT487 | page = 487 }}

The compound is commonly used as the methyl sulfate (metilsulfate).