bexlosteride

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477372371

| IUPAC_name = (4aR,10bR)-8-Chloro-4-methyl-1,4,4a,5,6,10b-hexahydrobenzo[f]quinolin-3(2H)-one

| image = Bexlosteride.svg

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 148905-78-6

| ATC_prefix = none

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 24955

| PubChem = 166562

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 36X732P4P0

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 145762

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H16ClNO/c1-16-13-6-2-9-8-10(15)3-4-11(9)12(13)5-7-14(16)17/h3-4,8,12-13H,2,5-7H2,1H3/t12-,13-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WQBIOEFDDDEARX-CHWSQXEVSA-N

| synonyms = LY 300502

| C=14 | H=16

| Cl=1 | N=1

| O=1

| smiles = CN1[C@@H]2CCc3cc(ccc3[C@H]2CCC1=O)Cl

}}

Bexlosteride is a potent and noncompetitive inhibitor of the enzyme 5α-reductase related to finasteride and dutasteride.{{Cite book | vauthors = Chang C | title = Androgens and androgen receptor : mechanisms, functions, and clinical application | date = 2002 | publisher = Kluwer Academic Publishers | location = Boston | isbn = 1-4020-7188-4 | url = https://books.google.com/books?id=ODBLQc2BdDIC&q=Bexlosteride&pg=PA167}}{{cite book | vauthors = Lednicer D | title = Strategies for Organic Drug Synthesis and Design | publisher = Wiley-Interscience | location = New York | year = 2008 | isbn = 978-0-470-19039-5 | url = https://books.google.com/books?id=fEwl6Qev-mUC&q=Bexlosteride&pg=PA208}} It is selective for the type I isoform of the enzyme. It advanced to Phase III clinical trials, but development was halted at that stage, and it was never marketed.{{cite web | url = http://adisinsight.springer.com/drugs/800009929 | title = Drug Profile: Bexlosteride| publisher = Adis Insight}}Reaxys entry for bexlosteride: Reaxys Registry Number: 6635310