binaltorphimine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (1S,2S,7S,8R,12S,20R,24R,32R)-11,33-bis(cyclopropylmethyl)-22-methyl-19,25-dioxa-11,22,33-triazaundecacyclo[24.9.1.1^8,14.0^1,24.0^2,32.0^4,23.0^5,21.0^7,12.0^8,20.0^18,37.0^30,36]heptatriaconta-4(23),5(21),14(37),15,17,26(36),27,29-octaene-2,7,17,27-tetrol

| image = Binaltorphimine.svg

| image_class = skin-invert-image

| width = 200px

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 105618-27-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 94L0JAS27S

| ATC_prefix = None

| ATC_suffix =

| PubChem = 5484197

| DrugBank =

| ChemSpiderID = 24673307

| ChEMBL = 610001

| C=41 | H=45 | N=3 | O=6

| smiles = CN1C2=C(C[C@]3([C@H]4CC5=C6[C@]3([C@H]2OC6=C(C=C5)O)CCN4CC7CC7)O)C8=C1[C@H]9[C@@]12CCN([C@@H]([C@@]1(C8)O)CC1=C2C(=C(C=C1)O)O9)CC1CC1

| StdInChI = 1S/C41H45N3O6/c1-42-32-24(16-40(47)28-14-22-6-8-26(45)34-30(22)38(40,36(32)49-34)10-12-43(28)18-20-2-3-20)25-17-41(48)29-15-23-7-9-27(46)35-31(23)39(41,37(50-35)33(25)42)11-13-44(29)19-21-4-5-21/h6-9,20-21,28-29,36-37,45-48H,2-5,10-19H2,1H3/t28-,29-,36+,37+,38+,39+,40-,41-/m1/s1

| StdInChIKey = DKIVQMBUHVYDFC-IWRYZOJTSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Binaltorphimine (BNI) is a selective antagonist of the κ-opioid receptor (KOR).{{cite journal |vauthors=Portoghese PS, Lipkowski AW, Takemori AE | title = Binaltorphimine and nor-binaltorphimine, potent and selective kappa-opioid receptor antagonists | journal = Life Sci. | volume = 40 | issue = 13 | pages = 1287–92 |date=March 1987 | pmid = 2882399 | doi = 10.1016/0024-3205(87)90585-6}} BNI and norbinaltorphimine (nor-BNI) were the first highly selective KOR antagonists to be discovered.