binospirone

{{Short description|Anxiolytic drug}}

{{Drugbox

| verifiedrevid = 444656919

| IUPAC_name = 8-[2-(2,3-dihydro-1,4-benzodioxin-2-ylmethylamino)ethyl]-8-azaspiro[4.5]decane-7,9-dione

| image = Binospirone.svg

| image2 = Binospirone_3D.gif

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 102908-59-8

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 124756-23-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T3M5D109V5

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 155R3B9K8H

| index2_label= mesylate

| ATC_prefix = none

| ATC_suffix =

| PubChem = 60769

| ChemSpiderID = 54766

| ChEMBL = 1487115

| smiles = O=C1N(C(=O)CC2(C1)CCCC2)CCNCC3Oc4ccccc4OC3

| StdInChI = 1S/C20H26N2O4/c23-18-11-20(7-3-4-8-20)12-19(24)22(18)10-9-21-13-15-14-25-16-5-1-2-6-17(16)26-15/h1-2,5-6,15,21H,3-4,7-14H2

| StdInChIKey = BVMYCHKQPGEOSI-UHFFFAOYSA-N

| C=20 | H=26 | N=2 | O=4

}}

Binospirone (MDL-73,005-EF) is a drug which acts as a partial agonist at 5-HT_1A somatodendritic autoreceptors but as an antagonist at postsynaptic 5-HT_1A receptors.{{cite journal | vauthors = Bertrand F, Lehmann O, Galani R, Lazarus C, Jeltsch H, Cassel JC | s2cid = 8595441 | title = Effects of MDL 73005 on water-maze performances and locomotor activity in scopolamine-treated rats | journal = Pharmacology, Biochemistry, and Behavior | volume = 68 | issue = 4 | pages = 647–60 | date = April 2001 | pmid = 11526961 | doi = 10.1016/S0091-3057(01)00448-8 | url = https://univoak.eu/islandora/object/islandora%3A84615 | url-access = subscription }} It has anxiolytic effects.{{cite journal | vauthors = Moser PC, Tricklebank MD, Middlemiss DN, Mir AK, Hibert MF, Fozard JR | title = Characterization of MDL 73005EF as a 5-HT1A selective ligand and its effects in animal models of anxiety: comparison with buspirone, 8-OH-DPAT and diazepam | journal = British Journal of Pharmacology | volume = 99 | issue = 2 | pages = 343–9 | date = February 1990 | pmid = 1970269 | pmc = 1917389 | doi = 10.1111/j.1476-5381.1990.tb14706.x }}