bisacurone
{{Chembox
| ImageFile = Bisacurone.svg
| ImageSize = 200px
| ImageAlt =
| PIN = (6S)-6-[(1R,4S,5S)-4,5-Dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 120681-81-4
| ChemSpiderID = 10259030
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SA836UFA35
| PubChem = 14287397
| SMILES = C[C@@H](CC(=O)C=C(C)C)[C@H]1C[C@@H]([C@@](C=C1)(C)O)O
| InChI=1S/C15H24O3/c1-10(2)7-13(16)8-11(3)12-5-6-15(4,18)14(17)9-12/h5-7,11-12,14,17-18H,8-9H2,1-4H3/t11-,12+,14-,15-/m0/s1
| InChIKey=QJOWFYQIUZMPRY-NEBZKDRISA-N
}}
| Section2 = {{Chembox Properties
| C=15|H=24|O=3
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Bisacurone is a chemical compound with the molecular formula C15H24O3 which has been isolated from turmeric (Curcuma longa). In vitro, it has several effects including anti-inflammatory, anti-oxidant, and anti-metastatic properties.{{cite journal | doi = 10.1016/j.intimp.2008.05.006| pmid = 18602074| title = Bisacurone inhibits adhesion of inflammatory monocytes or cancer cells to endothelial cells through down-regulation of VCAM-1 expression| journal = International Immunopharmacology| volume = 8| issue = 9| pages = 1272–1281| year = 2008| last1 = Sun| first1 = Dong-Il| last2 = Nizamutdinova| first2 = Irina Tsoy| last3 = Kim| first3 = Young Min| last4 = Cai| first4 = Xing Fu| last5 = Lee| first5 = Jung Joon| last6 = Kang| first6 = Sam Sik| last7 = Kim| first7 = Yeong Shik| last8 = Kang| first8 = Ki Mun| last9 = Chai| first9 = Gyu Young| last10 = Chang| first10 = Ki Churl| last11 = Kim| first11 = Hye Jung}}