bisnortilidine

{{Chembox

| ImageFile = Bisnortilidine structure.svg

| ImageSize = 200px

| ImageAlt =

| PIN = Ethyl (1R,2S)-2-amino[1,1′-bi(cyclohexane)]-1′,3,3′,5′-tetraene-1-carboxylate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 53948-51-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 58NDD17NUF

| PubChem = 162740

| ChemSpiderID = 454879

| InChI=1S/C15H19NO2/c1-2-18-14(17)15(11-7-6-10-13(15)16)12-8-4-3-5-9-12/h3-6,8-10,13H,2,7,11,16H2,1H3/t13-,15+/m0/s1

| InChIKey= BTKAMSWFNMGLGM-DZGCQCFKSA-N

| SMILES =CCOC(=O)[C@]1(CCC=C[C@@H]1N)C2=CC=CC=C2 }}

|Section2={{Chembox Properties

| C=15 | H=19 | N=1 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Bisnortilidine is an opioid metabolite.{{ cite journal | last1 = Wustrow | first1 = I. | last2 = Riedel | first2 = K. D. | last3 = Mikus | first3 = G. | last4 = Weiss | first4 = J. | title = In vitro identification of the cytochrome P450 isozymes involved in the N-demethylation of the active opioid metabolite nortilidine to bisnortilidine | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | year = 2012 | volume = 385 | issue = 6 | pages = 633–9 | doi = 10.1007/s00210-012-0737-z | pmid = 22349139 | s2cid = 2660215 }} It is formed from tilidine by demethylation in the liver.