bornyl acetate
{{Chembox
| ImageFile = Bornyl acetate.svg
| ImageSize = 150px
| ImageAlt =
| PIN = 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-yl acetate
| OtherNames =
| Section1 = {{Chembox Identifiers
| index1_label = (1S,2R,4S)-(-)
| index2_label = (1R,2S,4R)-(+)
| CASNo = 76-49-3
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 83962
| PubChem = 6448
| PubChem1 = 12025
| EC_number = 200-964-4
| RTECS = NP7350000
| KEGG1 = C09837
| KEGG2 = C11338
| ChEBI1 = 157
| ChEBI2 = 3151
| CASNo1 = 5655-61-8
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo2 = 20347-65-3
| CASNo2_Ref = {{cascite|correct|CAS}}
| UNII = 213431586X
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII1 = 24QAP1VCUX
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII2 = MN65CC8L89
| UNII2_Ref = {{fdacite|correct|FDA}}
| ChEMBL1 = 3183823
| StdInChI=1S/C12H20O2/c1-8(13)14-10-7-9-5-6-12(10,4)11(9,2)3/h9-10H,5-7H2,1-4H3
| StdInChIKey = KGEKLUUHTZCSIP-UHFFFAOYSA-N
| SMILES = CC(=O)OC1CC2CCC1(C2(C)C)C
}}
| Section2 = {{Chembox Properties
| C=12|H=20|O=2
| Appearance =
| Density =
| MeltingPt = 27–29 °C
| BoilingPt = 223–224 °C
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Bornyl acetate is a chemical compound.{{PubChem|6448}} Its molecular formula is C12H20O2 and its molecular weight is 196.29 g/mol. It is the acetate ester of borneol. It is used as a food additive,{{cite web | title = Code of Federal Regulations Title 21 | url = https://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?FR=172.515| archive-url = https://web.archive.org/web/20031011083118/http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?FR=172.515| url-status = dead| archive-date = October 11, 2003}} flavouring agent, and odour agent.
It is a component of the essential oil from pine needles (from the family Pinaceae){{cite journal | doi = 10.1080/0972060X.2013.764194| title = GC-MS Analyses of the Essential Oils Obtained from Pinaceae Leaves in Korea| journal = Journal of Essential Oil Bearing Plants| volume = 18| issue = 3| pages = 538| year = 2015| last1 = Lee| first1 = Na-Hyun| last2 = Lee| first2 = Sang-Min| last3 = Lee| first3 = Tae-Min| last4 = Chung| first4 = Namhyun| last5 = Lee| first5 = Hoi-Seon| bibcode = 2015JEOBP..18..538L| s2cid = 93566094}}{{cite journal | doi = 10.1080/0972060X.2012.10644040| title = Chemical Composition of the Hydrosol and the Essential Oil of Three Different Species of the Pinaceae Family :Picea glauca(Moench) Voss.,Picea mariana(Mill.) B.S.P., and Abies balsamea(L.) Mill| journal = Journal of Essential Oil Bearing Plants| volume = 15| issue = 2| pages = 227| year = 2012| last1 = Garneau| first1 = François-Xavier| last2 = Collin| first2 = Guy| last3 = Gagnon| first3 = Hélène| last4 = Pichette| first4 = André| bibcode = 2012JEOBP..15..227G| s2cid = 94394684}}{{cite journal | pmid = 25532297| year = 2014| last1 = Karapandzova| first1 = M| title = Chemical composition and antimicrobial activity of the essential oils of Pinus peuce (Pinaceae) growing wild in R. Macedonia| journal = Natural Product Communications| volume = 9| issue = 11| pages = 1623–8| last2 = Stefkova| first2 = G| last3 = Cvetkovikj| first3 = I| last4 = Trajkovska-Dokik| first4 = E| last5 = Kaftandzieva| first5 = A| last6 = Kulevanova| first6 = S| doi = 10.1177/1934578X1400901124| doi-access = free}} and primarily responsible for its odor.{{Cite book | url = https://books.google.com/books?id=Xwe3DQAAQBAJ&q=Bornyl+acetate+pinaceae&pg=PA1193 | title = Ullmann's Food and Feed | volume = 2 | publisher = Wiley-VCH | page = 1193| isbn = 9783527339907 | date = 2017-06-19 | quote = Pinaceae needle oils from Pinaceae species contain (-)-bornyl acetate as their main odoriferous component.}}