bromocresol purple

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443145525

| ImageFile = Bromocresol purple.svg

| ImageAlt = Skeletal formula of bromocresol purple in cyclic form

| ImageFile1 = Bromocresol purple cyclic 3D ball.png

| ImageAlt1 = Ball-and-stick model of the bromocresol purple molecule in cyclic form

| PIN = 3,3-Bis(3-bromo-4-hydroxy-5-methylphenyl)-2,1λ6-benzoxathiole-1,1(3H)-dione

| OtherNames = 5′,5′′-Dibromo-o-cresolsulfonephthalein
Bromcresol purple

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7974

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 86154

| EC_number = 204-087-8

| UNII = 201C22C3EC

| InChI = 1/C21H16Br2O5S/c1-11-7-13(9-16(22)19(11)24)21(14-8-12(2)20(25)17(23)10-14)15-5-3-4-6-18(15)29(26,27)28-21/h3-10,24-25H,1-2H3

| InChIKey = ABIUHPWEYMSGSR-UHFFFAOYAH

| InChI2 = 1/C21H17BrO5S/c1-12-9-14(7-8-18(12)23)21(15-10-13(2)20(24)17(22)11-15)16-5-3-4-6-19(16)28(25,26)27-21/h3-11,23-24H,1-2H3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H16Br2O5S/c1-11-7-13(9-16(22)19(11)24)21(14-8-12(2)20(25)17(23)10-14)15-5-3-4-6-18(15)29(26,27)28-21/h3-10,24-25H,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ABIUHPWEYMSGSR-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 115-40-2

| PubChem = 8273

| SMILES = Brc1c(O)c(cc(c1)C3(OS(=O)(=O)c2ccccc23)c4cc(c(O)c(Br)c4)C)C

}}

|Section2={{Chembox Properties

| C=21 | H=16 | Br=2 | O=5 | S=1

| Appearance = Purple powder

| Density =

| MeltingPtC = 241 to 242

| MeltingPt_notes = (decomposition)

| BoilingPt =

| Solubility = < 0.1 %

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| NFPA-H = 1

| NFPA-F = 0

| NFPA-R = 0

| NFPA-S =

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

}}

Bromocresol purple (BCP) or 5′,5″-dibromo-o-cresolsulfophthalein, is a dye of the triphenylmethane family (triarylmethane dyes) and a pH indicator. It is colored yellow below pH 5.2, and violet above pH 6.8. In its cyclic sulfonate ester form, it has a pKa value of 6.3, and is usually prepared as a 0.04% aqueous solution.{{cite web |url= https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8273| title = Bromocresol Purple |work= NCBI PubChem |publisher=National Center for Biotechnology Information}}

Uses

File:Bromocresol purple sample1.JPG

{{pH_indicator_template|indicator_name=Bromocresol purple|low_pH=5.2 |high_pH=6.8 |low_pH_color=yellow|high_pH_color=violet}}

Bromocresol purple is used in medical laboratories to measure albumin. Use of BCP in this application may provide some advantage over older methods using bromocresol green.{{Cite journal|last1=Bachmann|first1=Lorin M.|last2=Yu|first2=Min|last3=Boyd|first3=James C.|last4=Bruns|first4=David E.|last5=Miller|first5=W. Greg|date=2017-03-01|title=State of Harmonization of 24 Serum Albumin Measurement Procedures and Implications for Medical Decisions|journal=Clinical Chemistry|language=en|volume=63|issue=3|pages=770–779|doi=10.1373/clinchem.2016.262899|issn=0009-9147|pmid=28073902|doi-access=free}}{{Cite journal|last1=Ito|first1=Shigenori|last2=Yamamoto|first2=Daisuke|date=2010-02-02|title=Mechanism for the color change in bromocresol purple bound to human serum albumin|journal=Clinica Chimica Acta|volume=411|issue=3|pages=294–295|doi=10.1016/j.cca.2009.11.019|pmid=19932090}} In microbiology, it is used for staining dead cells based on their acidity, and for the isolation and assaying of lactic acid bacteria.{{cite journal |title=Fluorescent staining with bromocresol purple: a rapid method for determining yeast cell dead count developed as an assay of killer toxin activity. |journal=Yeast |pages=1207–1211 |volume=9 |issue=11 |first1=H. |last1=Kurzweilová |first2=K. |last2=Sigler |date=November 1993 |pmid=7509098 |doi=10.1002/yea.320091107|s2cid=44782970 }}{{cite journal |title=A differential medium for lactic acid-producing bacteria in a mixed culture |journal=Letters in Applied Microbiology |pages=676–681 |first1=H.M. |last1=Lee |first2=Y. |last2=Lee |date=June 2008 |pmid=18444977 |doi=10.1111/j.1472-765X.2008.02371.x |volume=46 |issue=6 |doi-access=free }} {{open access}}

In photographic processing, it can be used as an additive to acid stop baths to indicate that the bath has reached neutral pH and needs to be replaced.{{cite book |url=https://books.google.com/books?id=u67OCwAAQBAJ&pg=PT622 |title=The Darkroom Cookbook |first=Steve |last=Anchell |via=Google Books |year=2016 |edition=4 |publisher=Routledge |isbn=9781317337607}}

Bromocresol purple milk solids glucose agar is used as a medium used to distinguish dermatophytes from bacteria and other organisms in cases of ringworm fungus (T. verrucosum) infestation in cattle and other animals.{{cite book|last1=Kane|first1 = J.|last2 = Summerbell|first2 = R.|last3 = Sigler|first3 = L.|last4 = Krajden|first4 = S.|last5 = Land|first5 = G.|title = Laboratory Handbook of Dermatophytes: A Clinical Guide and Laboratory Handbook of Dermatophytes and Other Filamentous Fungi from Skin, Hair, and Nails|year = 1997|publisher = Star Publishing Company|location = Belmont, CA|isbn = 9780898631579}}{{cite book|last1 = Beneke|first1 = E. S.|last2 = Rogers|first2 = A. L.|edition = illustrated|title = Medical Mycology and Human Mycoses|year = 1996|publisher = Star Publishing Company|location = Belmont, CA|isbn = 9780898631753|pages = 85–90}}

=pH Indicator=

Similar to bromocresol green, the structure of bromocresol purple changes with pH. Changing the level of acidity causes a shift in the equilibrium between two different structures that have different colors. In near-neutral or alkaline solution, the chemical has a sulfonate structure that gives the solution a purple color. As the pH decreases, it converts to a sultone (cyclic sulfonic ester) that colors the solution yellow. In some microbiology tests, this change is used as an indicator of bacterial growth.{{cite journal |doi=10.1016/j.ifset.2022.103200 |title=Applications of natural polysaccharide-based pH-sensitive films in food packaging: Current research and future trends |date=2022 |last1=Li |first1=Nan |last2=Zhou |first2=Siyu |last3=Yang |first3=Xingbin |last4=Lin |first4=Dehui |journal=Innovative Food Science & Emerging Technologies |volume=82 }}{{Cite web |url=https://www.thomassci.com/FetchFile.ashx?id=2807195c-9bfc-46a6-b088-61dd6b1f3e42 |title=Archived copy |access-date=2022-02-15 |archive-date=2022-02-16 |archive-url=https://web.archive.org/web/20220216042922/https://www.thomassci.com/FetchFile.ashx?id=2807195c-9bfc-46a6-b088-61dd6b1f3e42 |url-status=dead }}

:400px

See also

References

{{reflist|30em}}