bufuralol

{{Chembox

| ImageFile = Bufuralol.svg

| ImageSize = 200px

| PIN = 2-(tert-Butylamino)-1-(7-ethyl-1-benzofuran-2-yl)ethan-1-ol

| OtherNames = 2-(tert-Butylamino)-1-(7-ethylbenzofuran-2-yl)ethan-1-ol
2-(tert-Butylamino)-1-(7-ethyl-1-benzofuran-2-yl)ethanol

|Section1={{Chembox Identifiers

| CASNo = 54340-62-4

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 71733

| ChemSpiderID = 64777

| ChEMBL = 296035

| UNII = 891H89GFT4

| SMILES = OC(c2oc1c(cccc1c2)CC)CNC(C)(C)C

| InChI = InChI=1S/C16H23NO2/c1-5-11-7-6-8-12-9-14(19-15(11)12)13(18)10-17-16(2,3)4/h6-9,13,17-18H,5,10H2,1-4H3

}}

|Section2={{Chembox Properties

| C=16 | H=23 | N=1 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| PregCat =

| PregCat_AU =

| PregCat_US =

}}

}}

Bufuralol is a potent beta-adrenoceptor antagonist with partial agonist activity.{{cite journal | pmid = 2878678 | year = 1986 | last1 = Pringle | first1 = TH | last2 = Francis | first2 = RJ | last3 = East | first3 = PB | last4 = Shanks | first4 = RG | title = Pharmacodynamic and pharmacokinetic studies on bufuralol in man | volume = 22 | issue = 5 | pages = 527–34 | pmc = 1401192 | journal = British Journal of Clinical Pharmacology | doi=10.1111/j.1365-2125.1986.tb02931.x}} It is metabolized by CYP2D6.{{cite web |author=Flockhart DA |title=Drug Interactions: Cytochrome P₄₅₀ Drug Interaction Table |publisher=Indiana University School of Medicine |year=2007 |url=http://medicine.iupui.edu/flockhart/table.htm}} Retrieved on July 2011

Most beta blockers are aryloxypropanolamine-based. In this rare exception, the benzofuran oxygen is part of a ring rather than derived from the epichlorohydrin precursor.