bunamidine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Bunamidine.svg

| image_class = skin-invert-image

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 3748-77-4

| PubChem = 13986

| ChemSpiderID = 11644438

| UNII = A9IW1G3P6C

| DrugBank = DB11501

| ChEMBL = 1355596

| IUPAC_name = N,N-Dibutyl-4-hexoxynaphthalene-1-carboximidamide

| C = 25 | H = 38 | N = 2 | O = 1

| StdInChI=1S/C25H38N2O/c1-4-7-10-13-20-28-24-17-16-23(21-14-11-12-15-22(21)24)25(26)27(18-8-5-2)19-9-6-3/h11-12,14-17,26H,4-10,13,18-20H2,1-3H3

| StdInChIKey = FGGFIMIICGZCCJ-UHFFFAOYSA-N

| SMILES = CCCCCCOC1=CC=C(C2=CC=CC=C21)C(=N)N(CCCC)CCCC

}}

Bunamidine is an anthelmintic drug used in veterinary medicine to treat infections by tapeworm parasites of the genus Taenia;{{cite web | url = https://go.drugbank.com/drugs/DB11501 | title = Bunamidine | work = DrugBank }} thus it is classified as a taeniacide.

It is also effective against Echinococcus granulosus (dog tapeworm){{cite journal | vauthors = Andersen FL, Loveless RM, Jensen LA | title = Efficacy of bunamidine hydrochloride against immature and mature stages of Echinococcus granulosus | journal = American Journal of Veterinary Research | volume = 36 | issue = 5 | pages = 673–675 | date = May 1975 | pmid = 1169897 }} and Hymenolepis diminuta (rat tapeworm).{{cite journal | doi = 10.1016/0304-4017(79)90008-6 | title = The effects of bunamidine HCL on Hymenolepis diminuta in vitro | date = 1979 | vauthors = Chatfield RC, Yeary RA | journal = Veterinary Parasitology | volume = 5 | issue = 2–3 | pages = 177–193 }}