butaclamol

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = (3S,4aS,13bS)-3-(2-Methyl-2-propanyl)-2,3,4,4a,8,9,13b,14-octahydro-1H-benzo[6,7]cyclohepta[1,2,3-de]pyrido[2,1-a]isoquinolin-3-ol

| image = Butaclamol.svg

| width = 222

| tradename =

| CAS_number = 36504-93-5

| PubChem = 37459

| IUPHAR_ligand = 62

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 73298

| ChemSpiderID = 34364

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A7A2802VNL

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 479587

| ATC_prefix = none

| C=25 | H=31 | N=1 | O=1

| smiles = CC(C)(C)C1(CCN2CC3C4=CC=CC=C4CCC5=C3C(=CC=C5)C2C1)O

}}

Butaclamol (AY-23,028) is a type of antipsychotic which was never marketed.{{cite book | url = https://books.google.com/books?id=wZawOvjGME0C&q=butaclamol&pg=PA1131 | title = Dictionary of organic compounds - Google Books | isbn = 978-0-412-54090-5 | vauthors = Buckingham J | year = 1985 | publisher = CRC Press }} Sold as the hydrochloride salt for use in research, the compound acts as a dopamine receptor antagonist.{{cite journal | vauthors = Hall DA, Strange PG | title = Evidence that antipsychotic drugs are inverse agonists at D2 dopamine receptors | journal = British Journal of Pharmacology | volume = 121 | issue = 4 | pages = 731–6 | date = June 1997 | pmid = 9208141 | pmc = 1564749 | doi = 10.1038/sj.bjp.0701196 }}

Synthesis:{{cite journal | vauthors=((Bruderlein, F. T.)), ((Humber, L. G.)), ((Voith, K.)) | journal=Journal of Medicinal Chemistry | title=Neuroleptic agents of the benzocycloheptapyridoisoquinoline series. 1. Syntheses and stereochemical and structural requirements for activity of butaclamol and related compounds | volume=18 | issue=2 | pages=185–188 | date= February 1975 | doi=10.1021/jm00236a016| pmid=1168258 }} Review:{{cite journal | vauthors=((Castañer, J.)), ((Chatterjee, S. S.)) | journal=Drugs of the Future | title=Butaclamol | volume=1 | issue=4 | pages=171 | date= 1976 | doi=10.1358/dof.1976.001.04.64761}} Book chapter:Chronicles of Drug Discovery, Volume 1, Edited by Jasjit S. Bindra and Daniel Lednicer, page 61, (L. G. Humber).

Chemistry

pKa = 7.15 (uncorrected for ionic strength){{cite journal | vauthors = Chrzanowski FA, McGrogan BA, Maryanoff BE | title = The pKa of butaclamol and the mode of butaclamol binding to central dopamine receptors | journal = Journal of Medicinal Chemistry | volume = 28 | issue = 3 | pages = 399–400 | date = March 1985 | pmid = 2579238 | doi = 10.1021/jm00381a022 }}

References