butaxamine

{{Short description|Mixture of isomers}}

{{Drugbox

| verifiedrevid = 447614957

| IUPAC_name = (1S,2S)-1-(2,5-Dimethoxyphenyl)-2-(tert-butylamino)propan-1-ol

| image = Butaxamine.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_UK =

| legal_US =

| synonyms = Butoxamine

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 1937-89-9

| ATC_prefix = None

| PubChem = 134495

| ChEMBL = 289093

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 118552

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0NM31M53PW

| C=15 | H=25 | N=1 | O=3

| smiles = C[C@@H]([C@@H](C1=C(C=CC(=C1)OC)OC)O)NC(C)(C)C

| StdInChI_Ref =

| StdInChI = 1S/C15H25NO3/c1-10(16-15(2,3)4)14(17)12-9-11(18-5)7-8-13(12)19-6/h7-10,14,16-17H,1-6H3/t10-,14-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = TWUSDDMONZULSC-HZMBPMFUSA-N

}}

Butaxamine (INN; also known as butoxamine) is a β₂-selective beta blocker.{{cite web |url=http://cancerweb.ncl.ac.uk/cgi-bin/omd?butoxamine |title=Definition: butoxamine from Online Medical Dictionary }}{{cite journal |vauthors=Hillman KL, Doze VA, Porter JE |title=Functional characterization of the beta-adrenergic receptor subtypes expressed by CA1 pyramidal cells in the rat hippocampus |journal=J. Pharmacol. Exp. Ther. |volume=314 |issue=2 |pages=561–7 |date=August 2005 |pmid=15908513 |doi=10.1124/jpet.105.084947 |s2cid=12446381 |url=http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=15908513}} Its primary use is in experimental situations in which blockade of β₂ receptors is necessary to determine the activity of the drug (i.e. if the β₂ receptor is completely blocked, but the given effect is still present, the given effect is not a characteristic of the β₂ receptor). It has no clinical use. An alternative name is α-(1-[tert-butylamino]ethyl)-2,5-dimethoxybenzyl alcohol.