butaxamine
{{Short description|Mixture of isomers}}
{{Drugbox
| verifiedrevid = 447614957
| IUPAC_name = (1S,2S)-1-(2,5-Dimethoxyphenyl)-2-(tert-butylamino)propan-1-ol
| image = Butaxamine.svg
| width = 200
| tradename =
| pregnancy_AU =
| pregnancy_US =
| legal_AU =
| legal_UK =
| legal_US =
| synonyms = Butoxamine
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 1937-89-9
| ATC_prefix = None
| PubChem = 134495
| ChEMBL = 289093
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 118552
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0NM31M53PW
| C=15 | H=25 | N=1 | O=3
| smiles = C[C@@H]([C@@H](C1=C(C=CC(=C1)OC)OC)O)NC(C)(C)C
| StdInChI_Ref =
| StdInChI = 1S/C15H25NO3/c1-10(16-15(2,3)4)14(17)12-9-11(18-5)7-8-13(12)19-6/h7-10,14,16-17H,1-6H3/t10-,14-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = TWUSDDMONZULSC-HZMBPMFUSA-N
}}
Butaxamine (INN; also known as butoxamine) is a β2-selective beta blocker.{{cite web |url=http://cancerweb.ncl.ac.uk/cgi-bin/omd?butoxamine |title=Definition: butoxamine from Online Medical Dictionary }}{{cite journal |vauthors=Hillman KL, Doze VA, Porter JE |title=Functional characterization of the beta-adrenergic receptor subtypes expressed by CA1 pyramidal cells in the rat hippocampus |journal=J. Pharmacol. Exp. Ther. |volume=314 |issue=2 |pages=561–7 |date=August 2005 |pmid=15908513 |doi=10.1124/jpet.105.084947 |s2cid=12446381 |url=http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=15908513}} Its primary use is in experimental situations in which blockade of β2 receptors is necessary to determine the activity of the drug (i.e. if the β2 receptor is completely blocked, but the given effect is still present, the given effect is not a characteristic of the β2 receptor). It has no clinical use. An alternative name is α-(1-[tert-butylamino]ethyl)-2,5-dimethoxybenzyl alcohol.
See also
References
{{reflist}}
{{Beta blockers}}
{{Adrenergic receptor modulators}}
Category:Beta-Hydroxyamphetamines
Category:Methoxyphenethylamines
{{pharma-stub}}