butixocort

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8S,9S,10R,11S,13S,14S,17R)-11-Hydroxy-10,13-dimethyl-3-oxo-17-(2-sulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] butanoate

| image = Butixocort.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 120815-74-9

| CAS_supplemental =

| class = Corticosteroid; Glucocorticoid

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 189904

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 164931

| UNII = 5D0M4JI29K

| KEGG =

| ChEBI =

| ChEMBL = 2104187

| C=25 | H=36 | O=5 | S=1

| SMILES = CCCC(=O)O[C@@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)O)C)C(=O)CS

| StdInChI_Ref =

| StdInChI = 1S/C25H36O5S/c1-4-5-21(29)30-25(20(28)14-31)11-9-18-17-7-6-15-12-16(26)8-10-23(15,2)22(17)19(27)13-24(18,25)3/h12,17-19,22,27,31H,4-11,13-14H2,1-3H3/t17-,18-,19-,22+,23-,24-,25-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = HOAKOHHSHOCDLI-TUFAYURCSA-N

| synonyms = Tixocortol butyrate; Tixocortol 17-butyrate; 11β,17α-Dihydroxy-21-mercaptopregn-4-ene-3,20-dione 17-butyrate; JO-1717

}}

Butixocort, also known as tixocortol butyrate, is a synthetic glucocorticoid corticosteroid.{{cite book|author=William Andrew Publishing|title=Pharmaceutical Manufacturing Encyclopedia, 3rd Edition|url=https://books.google.com/books?id=_J2ti4EkYpkC&pg=PA769|date=22 October 2013|publisher=Elsevier|isbn=978-0-8155-1856-3|pages=769–}}{{cite journal | vauthors = Belvisi MG, Hele DJ | title = Soft steroids: a new approach to the treatment of inflammatory airways diseases | journal = Pulmonary Pharmacology & Therapeutics | volume = 16 | issue = 6 | pages = 321–5 | date = 2003 | pmid = 14580922 | doi = 10.1016/S1094-5539(03)00105-6 }}