butobarbital

{{distinguish|Butabarbital}}

{{Short description|Barbiturate}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 459987937

| image = Butobarbital.svg

| width = 100

| alt =

| image2 = Butobarbital ball-and-stick.png

| width2 = 150

| alt2 =

| tradename = Soneryl

| Drugs.com = {{drugs.com|international|butobarbital}}

| pregnancy_category =

| routes_of_administration = By mouth

| ATC_prefix = N05

| ATC_suffix = CA03

| legal_AU = S8

| legal_AU_comment =

| legal_CA = Schedule IV

| legal_DE = Anlage II

| bioavailability =

| metabolism = Liver

| elimination_half-life =

| excretion = Kidney

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 77-28-1

| PubChem = 6473

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01353

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6229

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = OHZ8QAW6YC

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02618

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 404422

| IUPAC_name = 5-Butyl-5-ethyl-1,3-diazinane-2,4,6-trione

| C=10 | H=16 | N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(CCCC)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H16N2O3/c1-3-5-6-10(4-2)7(13)11-9(15)12-8(10)14/h3-6H2,1-2H3,(H2,11,12,13,14,15)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = STDBAQMTJLUMFW-UHFFFAOYSA-N

}}

Butobarbital, also called butobarbitone or butethal, Soneryl, and Neonal,{{drugs.com|international|butobarbital}} is a hypnotic drug which is a barbiturate derivative.{{cite book | vauthors = Nordegren T | chapter = Butobarbital |title=The A-Z encyclopedia of alcohol and drug abuse |date=2002 |publisher=Brown Walker Press |location=Parkland, Fla. |isbn=978-1-58112-404-0 |page=144 | chapter-url=https://books.google.com/books?id=4yaGePenGKgC&dq=Butobarbital&pg=PA144}} It was developed by Poulenc Brothers (now part of Sanofi) in 1921.{{cite patent | title = Verfahren zur Herstellung von n-Butylaethylbarbitursaeure | country = DE | number = 481129 | assign1 = ETS Poulenc Freres | pubdate = 3 February 1922 | gdate = 14 August 1929 | postscript = . }}