butoconazole

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443491891

| image = Butoconazole.svg

| alt =

| tradename = Gynazole-1, Mycelex-3

| Drugs.com = {{drugs.com|monograph|butoconazole}}

| MedlinePlus = a682012

| DailyMedID = Butoconazole

| pregnancy_AU = B3

| pregnancy_category =

| routes_of_administration = Vaginal cream

| ATC_prefix = G01

| ATC_suffix = AF15

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = OTC

| legal_US_comment = / Rx-only

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 64872-76-0

| CAS_number2 = 64872-77-1

| PubChem = 47472

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00639

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 43192

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0Q771797PH

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D00880

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3240

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1295

| IUPAC_name = (RS)-1-[4-(4-Chlorophenyl)-2-(2,6-dichlorophenyl)sulfanylbutyl]imidazole

| C=19 | H=17 | Cl=3 | N=2 | S=1

| smiles = Clc1ccc(cc1)CCC(Sc2c(Cl)cccc2Cl)Cn3ccnc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H17Cl3N2S/c20-15-7-4-14(5-8-15)6-9-16(12-24-11-10-23-13-24)25-19-17(21)2-1-3-18(19)22/h1-5,7-8,10-11,13,16H,6,9,12H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SWLMUYACZKCSHZ-UHFFFAOYSA-N

}}

Butoconazole (trade names Gynazole-1, Mycelex-3) is an imidazole antifungal used in gynecology. It is administered as a vaginal cream.{{cite journal | vauthors = Seidman LS, Skokos CK | title = An evaluation of butoconazole nitrate 2% site release vaginal cream (Gynazole-1) compared to fluconazole 150 mg tablets (Diflucan) in the time to relief of symptoms in patients with vulvovaginal candidiasis | journal = Infectious Diseases in Obstetrics and Gynecology | volume = 13 | issue = 4 | pages = 197–206 | date = December 2005 | pmid = 16338779 | pmc = 1784583 | doi = 10.1155/2005/453239 | doi-access = free }}Butoconazole {{drugs.com|monograph|butoconazole}}