cadralazine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443953677

| IUPAC_name = Ethoxy-N'-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide

| image = Cadralazine.svg

| width = 250

| image2 = Cadralazine-3D-spacefill.png

| width2 = 180

| alt2 = Cadralazine molecule

| tradename =

| Drugs.com = {{drugs.com|international|cadralazine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 64241-34-5

| ATC_prefix = C02

| ATC_suffix = DB04

| PubChem = 2515

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2106561

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8T96I3U713

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2420

| smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N

| C=12 | H=21 | N=5 | O=3

}}

Cadralazine is an antihypertensive of the hydrazinophthalazine chemical class.{{cite journal | vauthors = McTavish D, Young RA, Clissold SP | title = Cadralazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in the treatment of hypertension | journal = Drugs | volume = 40 | issue = 4 | pages = 543–60 | date = October 1990 | pmid = 2083513 | doi = 10.2165/00003495-199040040-00005 }}