calcium benzoate

{{short description|Chemical compound}}

{{Chembox

| Verifiedfields = changed

| verifiedrevid = 428821447

| ImageFile = Calcium benzoate.png

| ImageSize = 200px

| ImageFile1 = Calcium dibenzoate ball-and-stick.png

| PIN=Calcium dibenzoate

| OtherNames={{Unbulleted list|E213|Benzoic acid, calcium salt}}

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 56210

| InChI = 1/2C7H6O2.Ca/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2

| InChIKey = NSQPPSOSXWOZNH-NUQVWONBAQ

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2C7H6O2.Ca/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NSQPPSOSXWOZNH-UHFFFAOYSA-L

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=2090-05-3

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 3QDE968MKD

| PubChem=62425

| SMILES = [Ca+2].[O-]C(=O)c1ccccc1.[O-]C(=O)c1ccccc1

| EINECS = 218-235-4

}}

|Section2={{Chembox Properties

| Formula = Ca(C₇H₅O₂)₂

| MolarMass = 282.31 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility= 2.32 g/100 mL (0 °C)
2.72 g/100 mL (20 °C)
8.7 g/100 mL (100 °C)

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Calcium benzoate refers to the calcium salt of benzoic acid. When used in the food industry as a preservative, its E number is E213 (INS number 213); it is approved for use as a food additive in the EU,UK Food Standards Agency: {{cite web |url=http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist |title=Current EU approved additives and their E Numbers |accessdate=2011-10-27}} USA and Australia and New Zealand.{{cite web | work = Australia New Zealand Food Standards Code | url=http://www.comlaw.gov.au/Details/F2011C00827 |title=Standard 1.2.4 - Labelling of ingredients |date=8 September 2011 |accessdate=2011-10-27}}

The formulas and structures of calcium carboxylate derivatives of calcium and related metals are complex. Generally the coordination number is eight and the carboxylates form Ca-O bonds. Another variable is the degree of hydration.{{cite journal | doi = 10.1107/S0567740881005037 | title = The geometry of calcium carboxylate interactions in crystalline complexes | date = 1981 | last1 = Einspahr | first1 = H. | last2 = Bugg | first2 = C. E. | journal = Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry | volume = 37 | issue = 5 | pages = 1044–1052 | bibcode = 1981AcCrB..37.1044E }}