calycosin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477376646

| Name = Calycosin

| ImageFile = Calycosin.svg

| ImageSize = 220px

| ImageName = Chemical structure of calycosin

| ImageFile1 = Calycosin-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = Calycosin molecule

| IUPACName = 3′,7-Dihydroxy-4′-methoxyisoflavone

| SystematicName = 7-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one

| OtherNames = 7,3′-Dihydroxy-4′-methoxyisoflavone
3′-Hydroxyformononetin

|Section1={{Chembox Identifiers

| CASNo = 20575-57-9

| CASNo_Ref = {{cascite|changed|??}}

| CASNoOther =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 241608

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 09N3E8P7TA

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 17793

| PubChem = 5280448

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4444104

| SMILES = O=C\1c3c(O/C=C/1c2ccc(OC)c(O)c2)cc(O)cc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZZAJQOPSWWVMBI-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=16

| H=12

| O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Calycosin is an O-methylated isoflavone. It can be isolated from Astragalus membranaceus Bge. var. mongholicus{{Cite journal | doi = 10.1016/S0021-9673(02)00535-6| pmid = 12198969| title = Preparative isolation and purification of calycosin from Astragalus membranaceus Bge. var. mongholicus (Bge.) Hsiao by high-speed counter-current chromatography| journal = Journal of Chromatography A| volume = 962| issue = 1–2| pages = 243–7| year = 2002| last1 = Ma| first1 = Xiaofeng| last2 = Zhang| first2 = Tianyou| last3 = Wei| first3 = Yun| last4 = Tu| first4 = Pengfei| last5 = Chen| first5 = Yingjie| last6 = Ito| first6 = Yoichiro}} and Trifolium pratense L. (red clover).{{cite journal | doi = 10.1016/S0031-9422(00)94679-X| title = Identification of isoflavones calycosin and pseudobaptigenin in Trifolium pratense| journal = Phytochemistry| volume = 17| issue = 9| pages = 1683| year = 1978| last1 = Biggs| first1 = David R| last2 = Lane| first2 = Geoffrey A| bibcode = 1978PChem..17.1683B}}