camicinal
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = 1-
| image = Camicinal.svg
| width = 250px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 923565-21-3
| CAS_supplemental =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3C8348951H
| ATC_prefix =
| ATC_suffix =
| PubChem = 15984937
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 13116304
| KEGG = D10330
| C=25 | H=33 | F=1 | N=4 | O=1
| smiles = C[C@H]1CN(CCN1)CC2=CC=C(C=C2)CC(=O)N3CCC(CC3)NC4=CC(=CC=C4)F
| StdInChI = 1S/C25H33FN4O/c1-19-17-29(14-11-27-19)18-21-7-5-20(6-8-21)15-25(31)30-12-9-23(10-13-30)28-24-4-2-3-22(26)16-24/h2-8,16,19,23,27-28H,9-15,17-18H2,1H3/t19-/m0/s1
| StdInChIKey = RZKDEGZIFSJVNA-IBGZPJMESA-N
| synonyms = GSK962040
}}
Camicinal was a motilin agonist investigated for the treatment of gastroparesis.{{cite journal | vauthors = Barshop K, Kuo B | s2cid = 25896703 | title = The investigational drug camicinal for the treatment of gastroparesis | journal = Expert Opinion on Investigational Drugs | volume = 24 | issue = 1 | pages = 133–140 | date = January 2015 | pmid = 25341626 | doi = 10.1517/13543784.2015.975792 }}{{cite journal | vauthors = Hobson R, Farmer AD, Dewit OE, O'Donnell M, Hacquoil K, Robertson D, Barton ME, Dukes GE | display-authors = 6 | title = The effects of camicinal, a novel motilin agonist, on gastro-esophageal function in healthy humans-a randomized placebo controlled trial | journal = Neurogastroenterology and Motility | volume = 27 | issue = 11 | pages = 1629–37 | date = November 2015 | pmid = 26348542 | doi = 10.1111/nmo.12663 }}{{cite journal | vauthors = Chapman MJ, Deane AM, O'Connor SL, Nguyen NQ, Fraser RJ, Richards DB, Hacquoil KE, Vasist Johnson LS, Barton ME, Dukes GE | display-authors = 6 | title = The effect of camicinal (GSK962040), a motilin agonist, on gastric emptying and glucose absorption in feed-intolerant critically ill patients: a randomized, blinded, placebo-controlled, clinical trial | journal = Critical Care | volume = 20 | issue = 1 | pages = 232 | date = August 2016 | pmid = 27476581 | pmc = 4967996 | doi = 10.1186/s13054-016-1420-4 | doi-access = free }} It did not improve enteral feeding intolerance.{{cite journal | vauthors = Deane AM, Lamontagne F, Dukes GE, Neil D, Vasist L, Barton ME, Hacquoil K, Ou X, Richards D, Stelfox HT, Mehta S, Day AG, Chapman MJ, Heyland DK | title = Nutrition Adequacy Therapeutic Enhancement in the Critically Ill: A Randomized Double-Blind, Placebo-Controlled Trial of the Motilin Receptor Agonist Camicinal (GSK962040): The NUTRIATE Study | journal = Journal of Parenteral and Enteral Nutrition| volume = 42 | issue = 5 | pages = 949–459 | year = 2018 | pmid = 29957868 | doi = 10.1002/jpen.1038 }}
References
{{Reflist|2}}
{{Drugs for functional gastrointestinal disorders}}
Category:Drugs acting on the gastrointestinal system and metabolism
Category:Motilin receptor agonists
{{gastrointestinal-drug-stub}}