campestane

{{Chembox

| ImageFile = Campestane.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 5ξ-Campestane{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1528 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}

| SystematicName = (1R,3aS,3bR,5aΞ,9aS,9bS,11aR)-1-[(2R,5R)-5,6-Dimethylheptan-2-yl]-9a,11a-dimethylhexadecahydro-1H-cyclopenta[a]phenanthrene

| OtherNames =

|Section1={{Chembox Identifiers

| index1_label = 5α-Campestane

| CASNo1 = 50897-35-3

| PubChem = 6857532

| Beilstein =

| KEGG =

| ChEBI = 35518

| StdInChI= 1S/C28H50/c1-19(2)20(3)10-11-21(4)24-14-15-25-23-13-12-22-9-7-8-17-27(22,5)26(23)16-18-28(24,25)6/h19-26H,7-18H2,1-6H3/t20-,21-,22?,23+,24-,25+,26+,27+,28-/m1/s1

| StdInChIKey= WAAWMJYYKITCGF-SULSJXDKSA-N

| SMILES = C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4[C@@]3(CCCC4)C)C

| ChemSpiderID = 5256868

}}

|Section2={{Chembox Properties

| C=28 | H=50

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Campestane or 24R-methylcholestane is a tetracyclic triterpene.{{Cite journal| vauthors= Yakimchyk VS, Kazlova VV, Hurski AL, Savchenko RG, Kostyleva SA, Zhabinskii VN, Khripach VA | title = Enantioselective catalytic approach to the C23-C28 subunit of 24α-methyl steroids | journal = Steroids | year = 2019 | volume = 148 | pages = 82–90 | doi = 10.1016/j.steroids.2019.05.003 | pmid = 31100291 | s2cid = 153311334 }} Its derivative campesterol (campest-5-en-3β-ol) was first isolated from the rapeseed (Brassica campestris), hence the name.{{cite journal |doi=10.1021/ja01849a079 |year=1941 |last1=Fernholz |first1=Erhard |title=Isolation of a New Phytosterol: Campesterol |last2=MacPhillamy |first2=H. B. |journal=Journal of the American Chemical Society |volume=63 |issue=4 |pages=1155}}