canbisol
{{Short description|Synthetic cannabinoid derivative drug}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| class = Cannabinoid
| verifiedrevid = 451563858
| IUPAC_name = (6aR,9R,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-1,9-diol
| image = Canbisol Structure.svg
| image_class = skin-invert-image
| width = 250
| image2 = Canbisol 3D BS.png
| image_class2 = bg-transparent
| width2 = 250
| tradename =
| legal_status =
| routes_of_administration =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 56689-43-1
| ATC_prefix = none
| PubChem = 41969
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2105525
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = NZ1ZPC4WSF
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 16736847
| C = 24
| H = 38
| O = 3
| smiles = Oc1cc(C(C)(C)CCCCCC)cc(c1C2C3)OC(C)(C)C2CCC3O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H38O3/c1-6-7-8-9-12-23(2,3)16-13-20(26)22-18-15-17(25)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,17-19,25-26H,6-12,15H2,1-5H3/t17?,18-,19-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UEKGZFCGRQYMRM-MNNMKWMVSA-N
}}
Canbisol (Nabidrox) is a synthetic cannabinoid derivative that is the dimethylheptyl homologue of 9-nor-9β-hydroxyhexahydrocannabinol (HHC). It is a potent agonist at both the CB1 and CB2 receptors, with a binding affinity of 0.1 nM at CB1 and 0.2 nM at CB2.{{cite journal | vauthors = Rhee MH, Vogel Z, Barg J, Bayewitch M, Levy R, Hanus L, Breuer A, Mechoulam R | display-authors = 6 | title = Cannabinol derivatives: binding to cannabinoid receptors and inhibition of adenylylcyclase | journal = Journal of Medicinal Chemistry | volume = 40 | issue = 20 | pages = 3228–33 | date = September 1997 | pmid = 9379442 | doi = 10.1021/jm970126f }} It is mainly used in scientific research, in receptor binding studies to determine the structure and function of the cannabinoid receptors,{{cite journal | vauthors = Rhee MH, Nevo I, Bayewitch ML, Zagoory O, Vogel Z | title = Functional role of tryptophan residues in the fourth transmembrane domain of the CB(2) cannabinoid receptor | journal = Journal of Neurochemistry | volume = 75 | issue = 6 | pages = 2485–91 | date = December 2000 | pmid = 11080201 | doi = 10.1046/j.1471-4159.2000.0752485.x | s2cid = 18339666 | doi-access = }}{{cite journal | vauthors = Rhee MH | title = Functional role of serine residues of transmembrane dopamin VII in signal transduction of CB2 cannabinoid receptor | journal = Journal of Veterinary Science | volume = 3 | issue = 3 | pages = 185–91 | date = September 2002 | pmid = 12514330 | doi = 10.4142/jvs.2002.3.3.185| doi-access = free }}{{cite journal | vauthors = Zhang R, Hurst DP, Barnett-Norris J, Reggio PH, Song ZH | title = Cysteine 2.59(89) in the second transmembrane domain of human CB2 receptor is accessible within the ligand binding crevice: evidence for possible CB2 deviation from a rhodopsin template | journal = Molecular Pharmacology | volume = 68 | issue = 1 | pages = 69–83 | date = July 2005 | pmid = 15840841 | doi = 10.1124/mol.104.007823 | s2cid = 6488891 }} but has been made illegal in some countries due to its possible abuse potential as a cannabinomimetic drug.[http://www.opsi.gov.uk/si/si2009/draft/ukdsi_9780111486610_en_1 The Misuse of Drugs Act 1971 (Amendment) Order 2009]
See also
References
{{Reflist}}
{{Cannabinoids}}
{{Cannabinoidergics}}
{{cannabinoid-stub}}