carazolol

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(9H-carbazol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol

| image = Carazolol.svg

| width = 200

| tradename =

| Drugs.com = {{drugs.com|international|carazolol}}

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 57775-29-8

| ATCvet = yes

| ATC_prefix = C07

| ATC_suffix = AA90

| PubChem = 71739

| IUPHAR_ligand = 569

| ChEMBL = 324665

| ChemSpiderID = 64783

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 29PW75S82A

| C=18 | H=22 | N=2 | O=2

| smiles = OC(CNC(C)C)COc3cccc2c3c1c(cccc1)[nH]2

}}

Carazolol is a high affinity inverse agonist (also referred to as a beta blocker) of the β-adrenergic receptor.{{cite journal | vauthors = Innis RB, Corrēa FM, Synder SH | title = Carazolol, an extremely potent beta-adrenergic blocker: binding to beta-receptors in brain membranes | journal = Life Sci. | volume = 24 | issue = 24 | pages = 2255–64 | year = 1979 | pmid = 41147 | doi = 10.1016/0024-3205(79)90102-4 }}