carfecillin

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 448018743

| IUPAC_name = (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[ [3-oxo-3-(phenoxy)-2-phenylpropanoyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid

| image = Carfecillin.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 27025-49-6

| ATC_prefix = G01

| ATC_suffix = AA08

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3414

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H22N2O6S/c1-23(2)17(21(28)29)25-19(27)16(20(25)32-23)24-18(26)15(13-9-5-3-6-10-13)22(30)31-14-11-7-4-8-12-14/h3-12,15-17,20H,1-2H3,(H,24,26)(H,28,29)/t15?,16-,17+,20-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NZDASSHFKWDBBU-KVMCETHSSA-N

| PubChem = 33672

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 31054

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9UU4XDB74X

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1095283

| C=23 | H=22 | N=2 | O=6 | S=1

| smiles = O=C(O)[C@@H]3N4C(=O)[C@@H](NC(=O)C(c1ccccc1)C(=O)Oc2ccccc2)[C@H]4SC3(C)C

}}

Carfecillin is a beta-lactam antibiotic. It is a phenyl derivative of carbenicillin, acting as a prodrug.{{cite journal | vauthors = Basker MJ, Comber KR, Sutherland R, Valler GH | title = Carfecillin: antibacterial activity in vitro and in vivo | journal = Chemotherapy | volume = 23 | issue = 6 | pages = 424–35 | date = 1977 | pmid = 21771 | doi = 10.1159/000222012 }}