carmoterol

{{short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid =

| IUPAC_name = 8-Hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1H-quinolin-2-one

| image = Carmoterol.svg

| width = 255

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| routes_of_administration = Inhalation

| legal_status = Development terminated

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 147568-66-9

| ATC_prefix = None

| ATC_suffix =

| PubChem = 63952

| IUPHAR_ligand = 7582

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 57545

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9810NUL4D1

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1094785

| synonyms = TA-2005; CHF-4226

| C = 21

| H = 24

| N = 2

| O = 4

| smiles = C[C@H](CC1=CC=C(C=C1)OC)NC[C@@H](C2=C3C=CC(=O)NC3=C(C=C2)O)O

| StdInChI = 1S/C21H24N2O4/c1-13(11-14-3-5-15(27-2)6-4-14)22-12-19(25)16-7-9-18(24)21-17(16)8-10-20(26)23-21/h3-10,13,19,22,24-25H,11-12H2,1-2H3,(H,23,26)/t13-,19+/m1/s1

| StdInChIKey = IHOXNOQMRZISPV-YJYMSZOUSA-N

}}

Carmoterol (INN;{{cite journal|title=International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names: List 53|journal=WHO Drug Information|date=2005|volume=19|issue=1|page=74|url=https://www.who.int/medicines/publications/druginformation/innlists/RL53.pdf|access-date=25 March 2016}} development codes TA-2005 and CHF-4226) is a non-catechol{{cite book| vauthors = Mario C, Monica K |title=Clinical Asthma|date=2008|publisher=Mosby / Elsevier Health Sciences|location= Philadelphia, PA |isbn=978-0-323-04289-5|chapter=27. Bronchodilators: Beta2-Agonists and Anticholingercs}} experimental ultra-long-acting β adrenoreceptor agonist (ultra-LABA){{cite journal | vauthors = Cazzola M, Calzetta L, Matera MG | title = β(2) -adrenoceptor agonists: current and future direction | journal = British Journal of Pharmacology | volume = 163 | issue = 1 | pages = 4–17 | date = May 2011 | pmid = 21232045 | pmc = 3085864 | doi = 10.1111/j.1476-5381.2011.01216.x }} that was in clinical trials before 2010 when it has been withdrawn from further development based on evidence that the compound does not possess a competitive profile.{{cite web|title=Chiesi: Annual Report 2010 |url= http://www.chiesi.es/Assets/docs/Annual_report_2010.pdf |publisher=Chiesi Farmaceutici S.p.A.|access-date=27 March 2016|page=20}}

Preliminary studies indicated duration of its effect exceeding 24 hours after inhalation of 3 μg. The pharmacologic profile of this medication included the fact its potency in isolated guinea pig trachea is greater than that of formoterol and salmeterol. It is over 100 times more selective for bronchial muscle than myocardial tissue.{{cite web | vauthors = Donohue JF |title=New Options in COPD Therapy | work = Medscape |date=2006 |url= http://www.medscape.com/viewarticle/547182 |access-date=27 March 2016}}